The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-yl ((2S,3R)-4-((4-(2-((tert-butoxycarbonyl)amino)acetamido)-N-isobutylphenyl)sulfonamido)-3-hydroxy-1-phenylbutan-2-yl)carbamate ID: ALA5281851
Max Phase: Preclinical
Molecular Formula: C34H48N4O10S
Molecular Weight: 704.84
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21)S(=O)(=O)c1ccc(NC(=O)CNC(=O)OC(C)(C)C)cc1
Standard InChI: InChI=1S/C34H48N4O10S/c1-22(2)19-38(49(43,44)25-13-11-24(12-14-25)36-30(40)18-35-32(41)48-34(3,4)5)20-28(39)27(17-23-9-7-6-8-10-23)37-33(42)47-29-21-46-31-26(29)15-16-45-31/h6-14,22,26-29,31,39H,15-21H2,1-5H3,(H,35,41)(H,36,40)(H,37,42)/t26-,27-,28+,29-,31+/m0/s1
Standard InChI Key: SCVXZOOPDYIXHB-SQQOACJHSA-N
Molfile:
RDKit 2D
51 54 0 0 0 0 0 0 0 0999 V2000
2.9810 -2.6786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2666 -2.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5521 -2.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5521 -3.5035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8378 -2.2661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8378 -1.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1234 -1.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1234 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8378 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5521 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5521 -1.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8378 1.0307 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2510 1.7447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6642 1.0307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1234 1.4429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1234 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8378 2.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5521 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8378 3.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5908 1.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3052 1.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3052 2.2671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0196 1.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0196 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7339 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7339 -1.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4483 -1.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1626 -1.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1626 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4483 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7339 1.4429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7339 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0196 2.6793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4483 2.6793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1626 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2451 1.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4381 1.6143 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.8421 0.7361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3898 0.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1313 0.4694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0419 1.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8387 1.0645 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.4540 1.9924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9045 2.5969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6954 -2.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4099 -2.6786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1243 -2.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8387 -2.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1243 -1.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8387 -1.8536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6954 -1.4412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 2 0
5 3 1 0
6 5 1 0
6 7 2 0
7 8 1 0
8 9 2 0
10 9 1 0
10 11 2 0
11 6 1 0
9 12 1 0
12 13 2 0
12 14 2 0
15 12 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
20 15 1 0
21 20 1 0
21 22 1 6
23 21 1 0
23 24 1 6
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
28 29 1 0
29 30 2 0
30 25 1 0
31 23 1 0
32 31 1 0
33 32 2 0
34 32 1 0
35 34 1 6
36 35 1 0
36 37 1 1
36 38 1 0
38 39 1 0
39 40 1 0
41 40 1 0
41 36 1 0
41 42 1 1
43 41 1 0
43 44 1 0
44 35 1 0
1 45 1 0
45 46 1 0
46 47 1 0
47 48 1 0
47 49 1 0
47 50 1 0
45 51 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 704.84Molecular Weight (Monoisotopic): 704.3091AlogP: 3.26#Rotatable Bonds: 14Polar Surface Area: 181.83Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.39CX Basic pKa: ┄CX LogP: 3.45CX LogD: 3.45Aromatic Rings: 2Heavy Atoms: 49QED Weighted: 0.23Np Likeness Score: -0.39
References 1. Ghosh AK, Shahabi D, Kipfmiller M, Ghosh AK, Johnson M, Wang YF, Agniswamy J, Amano M, Weber IT, Mitsuya H.. (2023) Evaluation of darunavir-derived HIV-1 protease inhibitors incorporating P2' amide-derivatives: Synthesis, biological evaluation and structural studies., 83 [PMID:36738797 ] [10.1016/j.bmcl.2023.129168 ]