6-Bromo-2-methyl-3-(2-(trifluoromethyl)styryl)quinazolin-4(3H)-one

ID: ALA5281861

Max Phase: Preclinical

Molecular Formula: C18H12BrF3N2O

Molecular Weight: 409.21

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc2ccc(Br)cc2c(=O)n1/C=C/c1ccccc1C(F)(F)F

Standard InChI:  InChI=1S/C18H12BrF3N2O/c1-11-23-16-7-6-13(19)10-14(16)17(25)24(11)9-8-12-4-2-3-5-15(12)18(20,21)22/h2-10H,1H3/b9-8+

Standard InChI Key:  HMXVKWKZFUSBGK-CMDGGOBGSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   -3.5702   -0.2051    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -2.8557   -0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8557   -1.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1395   -1.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4296   -1.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7120   -1.8562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -1.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7139   -1.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -0.6188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7121   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4265   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8586   -0.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5702   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5702    0.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8539    1.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413    0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4268    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7123    0.6187    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.4268    1.8562    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7123    1.4436    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7171   -0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7171    0.6185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4296   -0.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1413   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
  9 22  1  0
 22 23  2  0
 24 22  1  0
  5 24  2  0
 24 25  1  0
 25  2  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5281861

    ---

Associated Targets(non-human)

Tobacco mosaic virus (2972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.21Molecular Weight (Monoisotopic): 408.0085AlogP: 5.11#Rotatable Bonds: 2
Polar Surface Area: 34.89Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.65CX LogP: 4.75CX LogD: 4.75
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.59Np Likeness Score: -1.02

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source