5-((4-methylpyridin-3-yl)methyl)imidazo[1,5-a]quinoxalin-4(5H)-one

ID: ALA5281879

Max Phase: Preclinical

Molecular Formula: C17H14N4O

Molecular Weight: 290.33

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccncc1Cn1c(=O)c2cncn2c2ccccc21

Standard InChI:  InChI=1S/C17H14N4O/c1-12-6-7-18-8-13(12)10-20-14-4-2-3-5-15(14)21-11-19-9-16(21)17(20)22/h2-9,11H,10H2,1H3

Standard InChI Key:  TWLGAAXWYXTXLT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
    1.7855   -0.0340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0710    0.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3566   -0.0340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3566   -0.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3578   -1.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0754   -0.8572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7855   -1.2736    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7855   -2.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708   -2.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3578   -2.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3578    0.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0678   -0.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7840    0.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7840    1.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0696    1.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3578    1.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3566    1.6159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5281    2.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3486    2.5090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6841    1.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0710    1.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565   -2.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
 11  3  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 11 16  2  0
 16 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 21 20  2  0
  2 21  1  0
 21 17  1  0
 10 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281879

    ---

Associated Targets(Human)

GABRA5 Tclin GABA receptor alpha-5 subunit (699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRA1 Tclin GABA receptor alpha-1 subunit (399 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 290.33Molecular Weight (Monoisotopic): 290.1168AlogP: 2.40#Rotatable Bonds: 2
Polar Surface Area: 52.19Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.61CX LogP: 1.66CX LogD: 1.65
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.57Np Likeness Score: -1.10

References

1. Károlyi BI, Potor A, Kapus GL, Fodor L, Bobok A, Krámos B, Magdó I, Bata I, Szabó G..  (2023)  Novel imidazo[1,5-a]quinoxaline derivatives: SAR, selectivity and modeling challenges en route to the identification of an α5-GABAA receptor NAM.,  80  [PMID:36549396] [10.1016/j.bmcl.2022.129107]

Source