O-ally allopregnananolone

ID: ALA5281882

Max Phase: Preclinical

Molecular Formula: C24H37NO3

Molecular Weight: 387.56

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](c4cc(CO)on4)CC[C@@H]32)C1

Standard InChI:  InChI=1S/C24H37NO3/c1-22(27)10-11-23(2)15(13-22)4-5-17-18-6-7-20(21-12-16(14-26)28-25-21)24(18,3)9-8-19(17)23/h12,15,17-20,26-27H,4-11,13-14H2,1-3H3/t15-,17-,18-,19-,20+,22+,23-,24-/m0/s1

Standard InChI Key:  WQANJTALVHXWJH-SFXVUFDXSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    1.7139    1.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4945    0.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9607   -0.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4671   -1.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6992   -0.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6992    0.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0137    0.4387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7266    0.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7266   -0.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4397   -1.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1526   -0.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8656   -1.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8656   -2.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1526   -2.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4397   -2.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7266   -2.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0137   -2.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0137   -1.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0137   -0.3839    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4397   -2.8519    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6883   -2.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2770   -2.7422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4397   -0.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7266   -1.6179    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7815    0.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7815   -1.6179    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1105    1.6453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5219    2.3858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2897    2.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4268    1.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8931    2.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6883    2.6326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  4  3  1  0
  5  4  1  0
  5  6  1  0
  6  2  1  0
  6  7  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 10 11  1  0
 12 11  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 10  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18  9  1  0
 18  5  1  0
 18 19  1  1
 15 20  1  6
 13 21  1  0
 13 22  1  6
 10 23  1  1
  9 24  1  6
  6 25  1  1
  5 26  1  6
 27  1  2  0
 27 28  1  0
 28 29  1  0
 30 29  2  0
  1 30  1  0
 29 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281882

    ---

Associated Targets(Human)

GABRA1 Tclin GABA-A receptor; alpha-1/beta-2/gamma-2 (1171 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRG2 Tclin Gamma-aminobutyric acid receptor subunit alpha-2/beta-1/gamma-2 (2 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.56Molecular Weight (Monoisotopic): 387.2773AlogP: 5.04#Rotatable Bonds: 2
Polar Surface Area: 66.49Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.35CX Basic pKa: 0.10CX LogP: 3.78CX LogD: 3.78
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.75Np Likeness Score: 1.66

References

1. Blanco MJ, La D, Coughlin Q, Newman CA, Griffin AM, Harrison BL, Salituro FG..  (2018)  Breakthroughs in neuroactive steroid drug discovery.,  28  (2): [PMID:29223589] [10.1016/j.bmcl.2017.11.043]

Source