The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-fluoro-N-((1-(4-(hydroxyamino)-1-(naphthalen-2-yl)-4-oxobutan-2-yl)-1H-1,2,3-triazol-4-yl)methyl)benzamide ID: ALA5281900
Max Phase: Preclinical
Molecular Formula: C24H22FN5O3
Molecular Weight: 447.47
Associated Items:
Names and Identifiers Canonical SMILES: O=C(C[C@H](Cc1ccc2ccccc2c1)n1cc(CNC(=O)c2ccc(F)cc2)nn1)NO
Standard InChI: InChI=1S/C24H22FN5O3/c25-20-9-7-18(8-10-20)24(32)26-14-21-15-30(29-27-21)22(13-23(31)28-33)12-16-5-6-17-3-1-2-4-19(17)11-16/h1-11,15,22,33H,12-14H2,(H,26,32)(H,28,31)/t22-/m0/s1
Standard InChI Key: RASCFMYPAZDCKQ-QFIPXVFZSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
0.5401 -1.0884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1272 -0.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1276 0.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9526 0.1811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2075 -0.6035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5401 -1.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2547 -2.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1744 -2.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9692 -1.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8889 -1.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6035 -2.3260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3181 -1.9135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8889 -1.0884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2849 0.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1100 0.8956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5225 1.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3476 1.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1100 2.3248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7604 0.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5830 0.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9958 1.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5866 2.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7620 2.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8209 1.6113 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9695 -1.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6823 -0.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3971 -1.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3987 -1.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6869 -2.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1054 -0.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8175 -1.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8209 -1.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1136 -2.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
1 6 1 0
6 7 1 1
6 8 1 0
7 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
10 13 2 0
3 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
19 17 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
17 23 1 0
21 24 1 0
25 9 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
9 29 1 0
27 30 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.47Molecular Weight (Monoisotopic): 447.1707AlogP: 3.18#Rotatable Bonds: 8Polar Surface Area: 109.14Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.89CX Basic pKa: 0.18CX LogP: 3.01CX LogD: 3.00Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -1.14
References 1. Legru A, Verdirosa F, Vo-Hoang Y, Tassone G, Vascon F, Thomas CA, Sannio F, Corsica G, Benvenuti M, Feller G, Coulon R, Marcoccia F, Devente SR, Bouajila E, Piveteau C, Leroux F, Deprez-Poulain R, Deprez B, Licznar-Fajardo P, Crowder MW, Cendron L, Pozzi C, Mangani S, Docquier JD, Hernandez JF, Gavara L.. (2022) Optimization of 1,2,4-Triazole-3-thiones toward Broad-Spectrum Metallo-β-lactamase Inhibitors Showing Potent Synergistic Activity on VIM- and NDM-1-Producing Clinical Isolates., 65 (24.0): [PMID:36450011 ] [10.1021/acs.jmedchem.2c01257 ]