The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-(3'-Furanyl)-akuammine ID: ALA5281919
Max Phase: Preclinical
Molecular Formula: C26H28N2O5
Molecular Weight: 448.52
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C1/CN2CC[C@@]34c5cc(O)c(-c6ccoc6)cc5N(C)[C@]35OC[C@@]4(C(=O)OC)[C@H]1C[C@H]25
Standard InChI: InChI=1S/C26H28N2O5/c1-4-15-12-28-7-6-25-19-10-21(29)17(16-5-8-32-13-16)9-20(19)27(2)26(25)22(28)11-18(15)24(25,14-33-26)23(30)31-3/h4-5,8-10,13,18,22,29H,6-7,11-12,14H2,1-3H3/b15-4-/t18-,22-,24-,25-,26+/m0/s1
Standard InChI Key: NJEIYBWSDKMJRU-MVIQYXFOSA-N
Molfile:
RDKit 2D
35 41 0 0 0 0 0 0 0 0999 V2000
-2.0789 -0.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8852 0.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0834 0.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4750 -0.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3545 0.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8523 0.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6819 0.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9860 -0.2074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8157 -0.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1198 -1.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9218 -1.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2260 -1.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5943 -1.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7648 -1.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4605 -0.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6586 -0.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0227 -1.2582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6962 -0.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4981 -1.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0504 -2.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1984 -0.3456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0879 0.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0755 0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1012 1.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9307 1.2858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5481 1.7283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8247 2.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8799 -1.4241 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8157 -2.5301 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4735 0.9338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8824 -0.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1803 -1.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0107 -1.4043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2260 -0.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5285 -0.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
4 3 1 0
5 4 1 0
5 6 1 6
7 6 1 0
8 7 1 0
9 8 1 0
10 9 1 0
11 10 2 0
12 11 1 0
10 13 1 0
14 13 1 0
15 14 1 0
8 15 1 0
16 15 1 0
5 16 1 0
17 16 1 0
18 17 1 0
4 18 2 0
18 19 1 0
19 1 2 0
17 20 1 0
16 21 1 1
22 21 1 0
23 22 1 1
5 23 1 0
13 23 1 0
23 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
15 28 1 6
13 29 1 1
2 30 1 0
1 31 1 0
32 31 2 0
32 33 1 0
33 34 1 0
34 35 2 0
35 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.52Molecular Weight (Monoisotopic): 448.1998AlogP: 3.28#Rotatable Bonds: 2Polar Surface Area: 75.38Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.56CX Basic pKa: 7.07CX LogP: 3.34CX LogD: 3.17Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: 2.16
References 1. Hennessy MR, Gutridge AM, French AR, Rhoda ES, Meqbil YJ, Gill M, Kashyap Y, Appourchaux K, Paul B, Wang ZJ, van Rijn RM, Riley AP.. (2023) Modified Akuamma Alkaloids with Increased Potency at the Mu-opioid Receptor., 66 (5): [PMID:36827198 ] [10.1021/acs.jmedchem.2c01707 ]