11-(3'-Furanyl)-akuammine

ID: ALA5281919

Max Phase: Preclinical

Molecular Formula: C26H28N2O5

Molecular Weight: 448.52

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C=C1/CN2CC[C@@]34c5cc(O)c(-c6ccoc6)cc5N(C)[C@]35OC[C@@]4(C(=O)OC)[C@H]1C[C@H]25

Standard InChI:  InChI=1S/C26H28N2O5/c1-4-15-12-28-7-6-25-19-10-21(29)17(16-5-8-32-13-16)9-20(19)27(2)26(25)22(28)11-18(15)24(25,14-33-26)23(30)31-3/h4-5,8-10,13,18,22,29H,6-7,11-12,14H2,1-3H3/b15-4-/t18-,22-,24-,25-,26+/m0/s1

Standard InChI Key:  NJEIYBWSDKMJRU-MVIQYXFOSA-N

Molfile:  

 
     RDKit          2D

 35 41  0  0  0  0  0  0  0  0999 V2000
   -2.0789   -0.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8852    0.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0834    0.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4750   -0.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3545    0.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8523    0.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6819    0.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9860   -0.2074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8157   -0.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1198   -1.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9218   -1.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2260   -1.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5943   -1.7559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7648   -1.6177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4605   -0.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6586   -0.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0227   -1.2582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6962   -0.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4981   -1.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0504   -2.0878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1984   -0.3456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0879    0.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0755    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1012    1.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9307    1.2858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5481    1.7283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8247    2.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8799   -1.4241    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8157   -2.5301    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4735    0.9338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8824   -0.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1803   -1.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0107   -1.4043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2260   -0.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5285   -0.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  4  3  1  0
  5  4  1  0
  5  6  1  6
  7  6  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 10 13  1  0
 14 13  1  0
 15 14  1  0
  8 15  1  0
 16 15  1  0
  5 16  1  0
 17 16  1  0
 18 17  1  0
  4 18  2  0
 18 19  1  0
 19  1  2  0
 17 20  1  0
 16 21  1  1
 22 21  1  0
 23 22  1  1
  5 23  1  0
 13 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 15 28  1  6
 13 29  1  1
  2 30  1  0
  1 31  1  0
 32 31  2  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281919

    ---

Associated Targets(Human)

OPRM1 Tclin Mu opioid receptor (19785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRK1 Tclin Kappa opioid receptor (16155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.52Molecular Weight (Monoisotopic): 448.1998AlogP: 3.28#Rotatable Bonds: 2
Polar Surface Area: 75.38Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.56CX Basic pKa: 7.07CX LogP: 3.34CX LogD: 3.17
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: 2.16

References

1. Hennessy MR, Gutridge AM, French AR, Rhoda ES, Meqbil YJ, Gill M, Kashyap Y, Appourchaux K, Paul B, Wang ZJ, van Rijn RM, Riley AP..  (2023)  Modified Akuamma Alkaloids with Increased Potency at the Mu-opioid Receptor.,  66  (5): [PMID:36827198] [10.1021/acs.jmedchem.2c01707]

Source