5-(4-chlorophenyl)-2-((3,5-dimethylphenyl)amino)nicotinonitrile

ID: ALA5281937

Max Phase: Preclinical

Molecular Formula: C20H16ClN3

Molecular Weight: 333.82

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C)cc(Nc2ncc(-c3ccc(Cl)cc3)cc2C#N)c1

Standard InChI:  InChI=1S/C20H16ClN3/c1-13-7-14(2)9-19(8-13)24-20-16(11-22)10-17(12-23-20)15-3-5-18(21)6-4-15/h3-10,12H,1-2H3,(H,23,24)

Standard InChI Key:  KHPPIRJAXBBVKS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -0.3547   -0.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3559   -1.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3568   -1.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0713   -1.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0684   -0.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3550    0.2031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7867   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4999   -1.8539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0668   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7793    0.2091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7762    1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4890    1.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4862    2.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7717    2.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0583    2.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0646    1.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3429    2.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1974    2.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7754   -1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4859   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4858   -2.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7693   -2.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0618   -2.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1974   -2.6767    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  3  0
  2  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 15 17  1  0
 13 18  1  0
  9 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23  9  1  0
 21 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281937

    ---

Associated Targets(Human)

NFE2L2 Tchem Nuclear factor erythroid 2-related factor 2 (95332 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 333.82Molecular Weight (Monoisotopic): 333.1033AlogP: 5.63#Rotatable Bonds: 3
Polar Surface Area: 48.71Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.38CX LogP: 5.92CX LogD: 5.92
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.67Np Likeness Score: -1.51

References

1. Hou Z, Lockwood L, Zhang D, Occhiuto CJ, Mo L, Aldrich KE, Stoub HE, Gallo KA, Liby KT, Odom AL..  (2023)  Exploring structural effects in a new class of NRF2 inhibitors.,  14  (1.0): [PMID:36760735] [10.1039/d2md00211f]

Source