(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxy-N-(piperidin-4-ylmethyl)tetrahydrofuran-2-carboxamide

ID: ALA5281978

Max Phase: Preclinical

Molecular Formula: C16H23N7O4

Molecular Weight: 377.41

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)NCC2CCNCC2)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C16H23N7O4/c17-13-9-14(21-6-20-13)23(7-22-9)16-11(25)10(24)12(27-16)15(26)19-5-8-1-3-18-4-2-8/h6-8,10-12,16,18,24-25H,1-5H2,(H,19,26)(H2,17,20,21)/t10-,11+,12-,16+/m0/s1

Standard InChI Key:  QORMXDVXCHKGRB-MEQWQQMJSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -1.5026   -0.3990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1800   -0.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0329   -1.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1782   -1.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8597   -0.2242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5077   -1.7234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8411   -1.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5594   -0.6203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5640   -1.4518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8403   -2.6251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2535    0.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5005    0.5873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4962    1.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2465    1.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7145    0.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1456    1.8386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4868    2.3789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5048    0.9933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8658    1.5133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0673    2.6251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5077    1.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1950    1.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1968    0.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8802    0.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5640    0.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5599    1.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8721    1.9854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  2  5  1  0
  3  6  2  0
  4  6  1  0
  4  7  1  0
  5  8  2  0
  7  9  2  0
  8  9  1  0
  7 10  1  0
 11  1  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 13 16  1  1
 14 17  1  6
 15 18  1  6
 16 19  1  0
 16 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 22 27  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281978

    ---

Associated Targets(Human)

METTL3 Tbio N6-adenosine-methyltransferase catalytic subunit (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.41Molecular Weight (Monoisotopic): 377.1812AlogP: -1.86#Rotatable Bonds: 4
Polar Surface Area: 160.44Molecular Species: BASEHBA: 10HBD: 5
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.39CX Basic pKa: 10.05CX LogP: -2.25CX LogD: -4.80
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.41Np Likeness Score: 0.41

References

1. Xu P, Ge R..  (2022)  Roles and drug development of METTL3 (methyltransferase-like 3) in anti-tumor therapy.,  230  [PMID:35063732] [10.1016/j.ejmech.2022.114118]

Source