(R)-3-(4-hydroxyphenyl)-2-(3-(4-methoxyphenyl)ureido)-N-((1-phenylcyclopropyl)methyl)propanamide

ID: ALA5282050

Max Phase: Preclinical

Molecular Formula: C27H29N3O4

Molecular Weight: 459.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=O)N[C@H](Cc2ccc(O)cc2)C(=O)NCC2(c3ccccc3)CC2)cc1

Standard InChI:  InChI=1S/C27H29N3O4/c1-34-23-13-9-21(10-14-23)29-26(33)30-24(17-19-7-11-22(31)12-8-19)25(32)28-18-27(15-16-27)20-5-3-2-4-6-20/h2-14,24,31H,15-18H2,1H3,(H,28,32)(H2,29,30,33)/t24-/m1/s1

Standard InChI Key:  HEDMOEAQWTUYFV-XMMPIXPASA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -1.4303   -0.4116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4303    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7159    0.8258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015   -0.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129   -0.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129   -1.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4293   -2.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1394   -1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8539   -2.0614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1394   -0.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129    0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129    1.6507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4273    0.4133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1418    0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8562    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2679   -0.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4429   -0.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5706    0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2882    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9998    0.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9998    1.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2836    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5706    1.6508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1448    0.8258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8592    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8592   -0.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5691   -0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2853   -0.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2853    0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5709    0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9998   -0.8277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9998   -1.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  1
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
 10  9  1  0
  9 11  2  0
 11 12  1  0
 12  6  2  0
  4 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 19 18  1  0
 17 19  1  0
 17 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 20  2  0
 26  2  1  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 27 32  1  0
 32 31  2  0
 30 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282050

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.55Molecular Weight (Monoisotopic): 459.2158AlogP: 3.98#Rotatable Bonds: 9
Polar Surface Area: 99.69Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.50CX Basic pKa: CX LogP: 4.05CX LogD: 4.05
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -0.64

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source