1-(N-(4-fluoro-3-(trifluoromethyl)benzyl)-N-(3-methylbenzo[b]thiophen-2-yl)sulfamoyl)piperidine-4-carboxylic acid

ID: ALA5282082

Max Phase: Preclinical

Molecular Formula: C23H22F4N2O4S2

Molecular Weight: 530.57

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(N(Cc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)N2CCC(C(=O)O)CC2)sc2ccccc12

Standard InChI:  InChI=1S/C23H22F4N2O4S2/c1-14-17-4-2-3-5-20(17)34-21(14)29(13-15-6-7-19(24)18(12-15)23(25,26)27)35(32,33)28-10-8-16(9-11-28)22(30)31/h2-7,12,16H,8-11,13H2,1H3,(H,30,31)

Standard InChI Key:  OVFDCTJFONNKBK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    0.5268   -2.9125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.1143   -2.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2981   -2.9125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.9393   -2.1981    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2981   -1.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1233   -1.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5357   -2.1981    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5350   -0.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1270   -0.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2985   -0.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1137   -0.7718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1139    0.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2985    1.3716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1139    2.0860    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6010    2.4989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1139    2.9125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9389    2.0860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3531    1.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1776    1.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5867    2.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4116    2.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8241    2.7994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8240    1.3706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1741    2.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3516    2.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1234    1.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5941    2.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3806    2.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3980    1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3980    0.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6153    0.7042    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1079    0.5383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8241    0.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8241    1.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1097    2.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  2  4  1  0
  5  2  1  0
  6  5  2  0
  6  7  1  0
  8  6  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  5 11  1  0
 12 10  1  0
 13 12  1  0
 13 14  1  0
 14 15  2  0
 14 16  2  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 21 20  1  0
 21 22  2  0
 21 23  1  0
 20 24  1  0
 24 25  1  0
 25 17  1  0
 26 13  1  0
 27 26  2  0
 27 28  1  0
 29 27  1  0
 30 29  2  0
 30 31  1  0
 31 26  1  0
 32 30  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 29 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282082

    ---

Associated Targets(Human)

TRPM8 Tclin Transient receptor potential cation channel subfamily M member 8 (1168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.57Molecular Weight (Monoisotopic): 530.0957AlogP: 5.42#Rotatable Bonds: 6
Polar Surface Area: 77.92Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.32CX Basic pKa: CX LogP: 4.93CX LogD: 1.99
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -1.61

References

1. Pérez de Vega MJ, Gómez-Monterrey I, Ferrer-Montiel A, González-Muñiz R..  (2016)  Transient Receptor Potential Melastatin 8 Channel (TRPM8) Modulation: Cool Entryway for Treating Pain and Cancer.,  59  (22): [PMID:27437828] [10.1021/acs.jmedchem.6b00305]

Source