The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6'-amino-5-chloro-2'-(4,4-dimethyl-2,6-dioxocyclohexylidene)-2-oxospiro[indoline-3,4'-[1,3]dithiine]-5'-carbonitrile ID: ALA5282102
Max Phase: Preclinical
Molecular Formula: C20H16ClN3O3S2
Molecular Weight: 445.95
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC(=O)C(=C2SC(N)=C(C#N)C3(S2)C(=O)Nc2ccc(Cl)cc23)C(=O)C1
Standard InChI: InChI=1S/C20H16ClN3O3S2/c1-19(2)6-13(25)15(14(26)7-19)17-28-16(23)11(8-22)20(29-17)10-5-9(21)3-4-12(10)24-18(20)27/h3-5H,6-7,23H2,1-2H3,(H,24,27)
Standard InChI Key: MHGWXEKFXSVQPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-3.6691 -0.2061 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.9545 -0.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9545 -1.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2399 -1.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5253 -1.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7283 -1.6902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2336 -1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5909 -1.0306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7283 -0.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0961 -0.3435 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.4809 0.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3054 0.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6902 1.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2504 1.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5148 1.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9545 0.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6691 0.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6416 0.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5697 -0.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7452 -0.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3604 -1.0031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0412 1.0856 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.7832 1.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2230 1.7727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1680 0.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9925 0.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8189 0.3435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5253 -0.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2399 -0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
9 7 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
19 20 1 0
20 12 1 0
20 21 2 0
11 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
9 25 1 0
26 25 1 0
26 27 3 0
28 9 1 0
5 28 2 0
28 29 1 0
29 2 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.95Molecular Weight (Monoisotopic): 445.0322AlogP: 3.83#Rotatable Bonds: ┄Polar Surface Area: 113.05Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.46CX Basic pKa: ┄CX LogP: 3.71CX LogD: 3.71Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -0.51
References 1. Brandão P, Marques C, Burke AJ, Pineiro M.. (2021) The application of isatin-based multicomponent-reactions in the quest for new bioactive and druglike molecules., 211 [PMID:33421712 ] [10.1016/j.ejmech.2020.113102 ]