Standard InChI: InChI=1S/C30H38N4O4/c1-3-22(35)10-5-4-6-12-25(33-29(36)30-13-16-34(17-14-30)18-15-30)28-31-20-26(38-28)23-19-21-9-7-8-11-24(21)32-27(23)37-2/h7-9,11,19-20,25H,3-6,10,12-18H2,1-2H3,(H,33,36)/t25-/m0/s1
1.Bresciani A, Ontoria JM, Biancofiore I, Cellucci A, Ciammaichella A, Di Marco A, Ferrigno F, Francone A, Malancona S, Monteagudo E, Nizi E, Pace P, Ponzi S, Rossetti I, Veneziano M, Summa V, Harper S.. (2019) Improved Selective Class I HDAC and Novel Selective HDAC3 Inhibitors: Beyond Hydroxamic Acids and Benzamides., 10 (4):[PMID:30996783][10.1021/acsmedchemlett.8b00517]