(E)-2,6-di-tert-butyl-4-((2-(4-(4-chlorophenyl)thiazol-2-yl)hydrazono)methyl)phenol

ID: ALA5282116

Max Phase: Preclinical

Molecular Formula: C24H28ClN3OS

Molecular Weight: 442.03

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1cc(/C=N/Nc2nc(-c3ccc(Cl)cc3)cs2)cc(C(C)(C)C)c1O

Standard InChI:  InChI=1S/C24H28ClN3OS/c1-23(2,3)18-11-15(12-19(21(18)29)24(4,5)6)13-26-28-22-27-20(14-30-22)16-7-9-17(25)10-8-16/h7-14,29H,1-6H3,(H,27,28)/b26-13+

Standard InChI Key:  UNJOWAWAQZCRHW-LGJNPRDNSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   -3.6742    0.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9596    0.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2477    0.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2477   -0.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9578   -1.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6742   -0.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3889    0.4696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9596    1.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6743    1.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1329    1.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5470    2.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3889   -1.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3889   -2.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8022   -0.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2148   -1.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5331   -1.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8184   -0.7677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1038   -1.1802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6107   -0.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6969    0.0525    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.5038    0.2240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9161   -0.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3642   -1.1031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7413   -0.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1541    0.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9768    0.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3896   -0.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9804   -1.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1557   -1.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2148   -0.4912    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  2  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  6 12  1  0
 12 13  1  0
 12 14  1  0
 12 15  1  0
  4 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  2  0
 24 22  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 24 29  1  0
 29 28  2  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282116

    ---

Associated Targets(Human)

MGAM Tclin Alpha glucosidase (860 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.03Molecular Weight (Monoisotopic): 441.1642AlogP: 7.21#Rotatable Bonds: 4
Polar Surface Area: 57.51Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.34CX Basic pKa: 5.51CX LogP: 8.57CX LogD: 8.52
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: -1.39

References

1. He M, Li YJ, Shao J, Li YS, Cui ZN..  (2023)  Synthesis and biological evaluation of 2,5-disubstituted furan derivatives containing 1,3-thiazole moiety as potential α-glucosidase inhibitors.,  83  [PMID:36764471] [10.1016/j.bmcl.2023.129173]

Source