The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-fluorophenyl)-3-(4-methylphenyl)-N-phenyl-4,5-dihydro-1H-pyrazole-1-carbothioamide ID: ALA5282135
Max Phase: Preclinical
Molecular Formula: C23H20FN3S
Molecular Weight: 389.50
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C2=NN(C(=S)Nc3ccccc3)C(c3ccc(F)cc3)C2)cc1
Standard InChI: InChI=1S/C23H20FN3S/c1-16-7-9-17(10-8-16)21-15-22(18-11-13-19(24)14-12-18)27(26-21)23(28)25-20-5-3-2-4-6-20/h2-14,22H,15H2,1H3,(H,25,28)
Standard InChI Key: NGWDAWTZAYXPLB-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
-1.3059 1.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4809 1.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2307 0.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8843 -0.2105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5518 0.2814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5659 0.0466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1493 0.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9435 0.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1570 -0.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5778 -0.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7803 -0.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7183 1.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5432 1.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9536 2.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5411 3.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7204 3.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3041 2.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8843 -1.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1699 -1.4478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5986 -1.4478 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.9536 -0.5942 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.1699 -2.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5442 -2.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5434 -3.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1710 -3.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8825 -3.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8873 -2.6867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9535 3.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 2 0
5 4 1 0
6 3 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
6 11 1 0
11 10 2 0
12 1 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
12 17 1 0
17 16 2 0
4 18 1 0
18 19 1 0
18 20 2 0
9 21 1 0
19 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
15 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.50Molecular Weight (Monoisotopic): 389.1362AlogP: 5.68#Rotatable Bonds: 3Polar Surface Area: 27.63Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.99CX Basic pKa: 1.57CX LogP: 6.35CX LogD: 6.35Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.58Np Likeness Score: -1.65
References 1. Nehra B, Rulhania S, Jaswal S, Kumar B, Singh G, Monga V.. (2020) Recent advancements in the development of bioactive pyrazoline derivatives., 205 [PMID:32795767 ] [10.1016/j.ejmech.2020.112666 ]