The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1,N1'-([1,1'-biphenyl]-4,4'-diylbis(methylene))bis(N3-cyclohexylpropane-1,3-diamine) ID: ALA5282178
Max Phase: Preclinical
Molecular Formula: C32H50N4
Molecular Weight: 490.78
Associated Items:
Names and Identifiers Canonical SMILES: c1cc(-c2ccc(CNCCCNC3CCCCC3)cc2)ccc1CNCCCNC1CCCCC1
Standard InChI: InChI=1S/C32H50N4/c1-3-9-31(10-4-1)35-23-7-21-33-25-27-13-17-29(18-14-27)30-19-15-28(16-20-30)26-34-22-8-24-36-32-11-5-2-6-12-32/h13-20,31-36H,1-12,21-26H2
Standard InChI Key: PQFXBEBLUJRZQA-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-1.7839 1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0694 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3575 1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3575 0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0675 -0.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7839 0.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3571 -0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0719 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7840 -0.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7840 -1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0737 -1.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3571 -1.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4986 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2133 -1.0311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9279 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6425 -1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3572 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0718 -1.0311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7864 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4986 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2132 1.0311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9278 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6425 1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3571 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0717 1.0311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.7864 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5010 1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2157 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2157 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5010 2.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7864 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5011 -1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2157 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2157 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5011 -2.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7864 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 4 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
7 12 1 0
12 11 2 0
10 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
1 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
27 26 1 0
28 27 1 0
29 28 1 0
30 29 1 0
31 30 1 0
26 31 1 0
32 19 1 0
33 32 1 0
34 33 1 0
35 34 1 0
36 35 1 0
19 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.78Molecular Weight (Monoisotopic): 490.4035AlogP: 6.16#Rotatable Bonds: 15Polar Surface Area: 48.12Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.89CX LogP: 5.73CX LogD: -0.93Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -0.28
References 1. Fang X, Meng Q, Zhang H, Liang B, Zhu S, Wang J, Zhang C, Huang LS, Zhang X, Schooley RT, An J, Xu Y, Huang Z.. (2020) Design, synthesis, and biological characterization of a new class of symmetrical polyamine-based small molecule CXCR4 antagonists., 200 [PMID:32492596 ] [10.1016/j.ejmech.2020.112410 ]