N1,N1'-([1,1'-biphenyl]-4,4'-diylbis(methylene))bis(N3-cyclohexylpropane-1,3-diamine)

ID: ALA5282178

Max Phase: Preclinical

Molecular Formula: C32H50N4

Molecular Weight: 490.78

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1cc(-c2ccc(CNCCCNC3CCCCC3)cc2)ccc1CNCCCNC1CCCCC1

Standard InChI:  InChI=1S/C32H50N4/c1-3-9-31(10-4-1)35-23-7-21-33-25-27-13-17-29(18-14-27)30-19-15-28(16-20-30)26-34-22-8-24-36-32-11-5-2-6-12-32/h13-20,31-36H,1-12,21-26H2

Standard InChI Key:  PQFXBEBLUJRZQA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -1.7839    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0694    1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575    1.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0675   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7839    0.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7840   -0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7840   -1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0737   -1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571   -1.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2133   -1.0311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9279   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6425   -1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3572   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0718   -1.0311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7864   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2132    1.0311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9278    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6425    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3571    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0717    1.0311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7864    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5010    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2157    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2157    2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5010    2.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7864    2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5011   -1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2157   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2157   -2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5011   -2.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7864   -2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  4  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  7 12  1  0
 12 11  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  1 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 26 31  1  0
 32 19  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 19 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282178

    ---

Associated Targets(Human)

CXCR4 Tclin C-X-C chemokine receptor type 4 (3338 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.78Molecular Weight (Monoisotopic): 490.4035AlogP: 6.16#Rotatable Bonds: 15
Polar Surface Area: 48.12Molecular Species: BASEHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.89CX LogP: 5.73CX LogD: -0.93
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -0.28

References

1. Fang X, Meng Q, Zhang H, Liang B, Zhu S, Wang J, Zhang C, Huang LS, Zhang X, Schooley RT, An J, Xu Y, Huang Z..  (2020)  Design, synthesis, and biological characterization of a new class of symmetrical polyamine-based small molecule CXCR4 antagonists.,  200  [PMID:32492596] [10.1016/j.ejmech.2020.112410]

Source