ID: ALA5282239

Max Phase: Preclinical

Molecular Formula: C16H20O6

Molecular Weight: 308.33

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1C[C@H]2OC(=O)C(C3CO3)[C@H]2[C@H](O)[C@]2(C)C(=O)C3OC3[C@@H]12

Standard InChI:  InChI=1S/C16H20O6/c1-5-3-6-8(9(7-4-20-7)15(19)21-6)13(17)16(2)10(5)11-12(22-11)14(16)18/h5-13,17H,3-4H2,1-2H3/t5-,6-,7?,8+,9?,10-,11?,12?,13+,16-/m1/s1

Standard InChI Key:  FCXFDQQIQQFQFU-XVXIILPASA-N

Molfile:  

 
     RDKit          2D

 25 29  0  0  0  0  0  0  0  0999 V2000
   -0.9451    1.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2970    1.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5073    1.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8661    0.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5079   -0.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2970   -0.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9451    0.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7055    0.5005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8495   -0.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1125   -0.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5108   -1.1096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7565   -0.0487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2315    0.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7350    1.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9703   -0.8469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5651    1.3765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5651   -0.7109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1125   -1.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5108    2.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1589    1.8345    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9451   -0.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4505    1.2066    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5079   -0.9538    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1125   -2.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8281   -1.9318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  1  0
  7  6  1  0
  4  8  1  0
  8  9  1  0
 10  9  1  0
  5 10  1  0
  6 11  1  6
  7 12  1  0
 12 13  1  0
 14 13  1  0
  1 14  1  0
 12 15  2  0
 13 16  1  0
 14 16  1  0
  9 17  2  0
 10 18  1  0
  2 19  1  6
  1 20  1  6
  7 21  1  1
  4 22  1  6
  5 23  1  6
 24 18  1  0
 24 25  1  0
 18 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282239

    ---

Associated Targets(Human)

HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.33Molecular Weight (Monoisotopic): 308.1260AlogP: -0.08#Rotatable Bonds: 1
Polar Surface Area: 88.66Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.25CX LogD: 0.25
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.54Np Likeness Score: 2.59

References

1. Gomes AR, Varela CL, Tavares-da-Silva EJ, Roleira FMF..  (2020)  Epoxide containing molecules: A good or a bad drug design approach.,  201  [PMID:32526552] [10.1016/j.ejmech.2020.112327]

Source