4-(3,5-dimethoxystyryl)phenyl 2-((5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)thio)acetate

ID: ALA5282254

Max Phase: Preclinical

Molecular Formula: C25H21N3O5S

Molecular Weight: 475.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/c2ccc(OC(=O)CSc3nnc(-c4ccncc4)o3)cc2)cc(OC)c1

Standard InChI:  InChI=1S/C25H21N3O5S/c1-30-21-13-18(14-22(15-21)31-2)4-3-17-5-7-20(8-6-17)32-23(29)16-34-25-28-27-24(33-25)19-9-11-26-12-10-19/h3-15H,16H2,1-2H3/b4-3+

Standard InChI Key:  HYOYIFNERWSFTP-ONEGZZNKSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -5.8178   -0.0832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1032    0.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3913   -0.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3913   -0.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1014   -1.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8178   -0.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1014   -2.1450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3868   -2.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6767    0.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9620   -0.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2474    0.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2472    1.1550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5343    1.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8194    1.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8179    0.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5297   -0.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1049    1.5655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6097    1.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3244    1.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0390    1.1530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7536    1.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8398    2.3858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6466    2.5573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0590    1.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5071    1.2301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8842    1.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2970    2.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1197    2.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5324    1.8420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1233    1.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2986    1.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6097    0.3277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5324    0.3293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5324    1.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  3  9  1  0
  9 10  2  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 24 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 18 32  2  0
  1 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282254

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PANC-1 (6144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.53Molecular Weight (Monoisotopic): 475.1202AlogP: 5.02#Rotatable Bonds: 9
Polar Surface Area: 96.57Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.48CX LogP: 4.07CX LogD: 4.07
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.14Np Likeness Score: -1.04

References

1. Ahmadi R, Ebrahimzadeh MA..  (2020)  Resveratrol - A comprehensive review of recent advances in anticancer drug design and development.,  200  [PMID:32485531] [10.1016/j.ejmech.2020.112356]

Source