6-Bromo-3-(4-chloro-3-nitrostyryl)-2-methylquinazolin-4(3H)-one

ID: ALA5282272

Max Phase: Preclinical

Molecular Formula: C17H11BrClN3O3

Molecular Weight: 420.65

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc2ccc(Br)cc2c(=O)n1/C=C/c1ccc(Cl)c([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C17H11BrClN3O3/c1-10-20-15-5-3-12(18)9-13(15)17(23)21(10)7-6-11-2-4-14(19)16(8-11)22(24)25/h2-9H,1H3/b7-6+

Standard InChI Key:  JTQZAHSOYIEGCB-VOTSOKGWSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   -3.9264   -0.4103    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -3.2120   -0.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2120   -1.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4958   -2.0590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7859   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0683   -2.0614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3569   -1.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3575   -2.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3569   -0.8240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3556   -0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0700   -0.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845   -0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5020   -0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2121   -0.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2121    0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4974    0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4974    1.6489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7830    2.0614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2118    2.0614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9264    0.8239    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.0734   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0734    0.4132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7859   -0.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4976   -0.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 18 16  1  0
 18 19  2  0
 18 20  1  0
 15 21  1  0
  9 22  1  0
 22 23  2  0
 24 22  1  0
  5 24  2  0
 24 25  1  0
 25  2  2  0
M  CHG  2  18   1  20  -1
M  END

Alternative Forms

  1. Parent:

    ALA5282272

    ---

Associated Targets(non-human)

Tobacco mosaic virus (2972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.65Molecular Weight (Monoisotopic): 418.9672AlogP: 4.66#Rotatable Bonds: 3
Polar Surface Area: 78.03Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.64CX LogP: 4.42CX LogD: 4.42
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.46Np Likeness Score: -1.22

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source