8-cyclopentyl-2-(ethylamino)-6-((1-(methylsulfonyl)piperidin-4-yl)amino)pteridin-7(8H)-one

ID: ALA5282292

Max Phase: Preclinical

Molecular Formula: C19H29N7O3S

Molecular Weight: 435.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCNc1ncc2nc(NC3CCN(S(C)(=O)=O)CC3)c(=O)n(C3CCCC3)c2n1

Standard InChI:  InChI=1S/C19H29N7O3S/c1-3-20-19-21-12-15-17(24-19)26(14-6-4-5-7-14)18(27)16(23-15)22-13-8-10-25(11-9-13)30(2,28)29/h12-14H,3-11H2,1-2H3,(H,22,23)(H,20,21,24)

Standard InChI Key:  HCIRRIUPOKDAOX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -2.4998    1.4594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7852    1.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0733    1.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0733    0.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7833    0.2228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4998    0.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3586    0.2220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559    0.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559    1.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3586    1.8724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705    0.2220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3586   -0.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3085   -1.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0536   -1.8724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7710   -1.8724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0259   -1.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705    1.8724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7852    1.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    1.8724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    1.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    0.6346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    0.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7852    0.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9291    0.2220    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.6437    0.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5157   -0.4939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3416   -0.4939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2144    0.2183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291    0.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6437    0.2183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  3 10  1  0
  8 11  2  0
 12  7  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
  9 17  1  0
 17 18  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 18 23  1  0
 21 24  1  0
 24 25  1  0
 24 26  2  0
 24 27  2  0
  6 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282292

    ---

Associated Targets(Human)

CCNE1 Tchem Cyclin-dependent kinase 2/cyclin E (1410 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.55Molecular Weight (Monoisotopic): 435.2053AlogP: 1.57#Rotatable Bonds: 6
Polar Surface Area: 122.11Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.71CX LogP: -0.19CX LogD: -0.19
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.70Np Likeness Score: -1.50

References

1. Wang X, Ding L, Jiang H, Yuan X, Xiang L, Tang C..  (2023)  Synthesis and biological evaluation of novel pteridin-7(8H)-one derivatives as potent CDK2 inhibitors.,  88  [PMID:37060933] [10.1016/j.bmcl.2023.129284]

Source