(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxy-N-(1-methylpiperidin-4-yl)tetrahydrofuran-2-carboxamide

ID: ALA5282296

Max Phase: Preclinical

Molecular Formula: C16H23N7O4

Molecular Weight: 377.41

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCC(NC(=O)[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)CC1

Standard InChI:  InChI=1S/C16H23N7O4/c1-22-4-2-8(3-5-22)21-15(26)12-10(24)11(25)16(27-12)23-7-20-9-13(17)18-6-19-14(9)23/h6-8,10-12,16,24-25H,2-5H2,1H3,(H,21,26)(H2,17,18,19)/t10-,11+,12-,16+/m0/s1

Standard InChI Key:  ROJYDYHGBJZLCS-MEQWQQMJSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -1.4888   -0.6868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1663   -0.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0192   -1.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1646   -1.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8461   -0.5120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4939   -2.0113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8274   -2.1556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5459   -0.9081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5504   -1.7396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8267   -2.9130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2397    0.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4867    0.2996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4824    1.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2328    1.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7008    0.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1594    1.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4730    2.0913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4911    0.7057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8798    1.2256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0811    2.3375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5467    1.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2453    1.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9107    1.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8815    2.4918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1811    2.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5098    2.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5504    2.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  2  5  1  0
  3  6  2  0
  4  6  1  0
  4  7  1  0
  5  8  2  0
  7  9  2  0
  8  9  1  0
  7 10  1  0
 11  1  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 13 16  1  1
 14 17  1  6
 15 18  1  6
 16 19  1  0
 16 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 21 26  1  0
 25 26  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282296

    ---

Associated Targets(Human)

METTL3 Tbio N6-adenosine-methyltransferase catalytic subunit (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.41Molecular Weight (Monoisotopic): 377.1812AlogP: -1.76#Rotatable Bonds: 3
Polar Surface Area: 151.65Molecular Species: BASEHBA: 10HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.39CX Basic pKa: 8.57CX LogP: -2.33CX LogD: -3.53
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.49Np Likeness Score: 0.20

References

1. Xu P, Ge R..  (2022)  Roles and drug development of METTL3 (methyltransferase-like 3) in anti-tumor therapy.,  230  [PMID:35063732] [10.1016/j.ejmech.2022.114118]

Source