N,N'-(((2S,2aS,4aS,6S,6aS)-2,6-dimethylhexahydro-1,3,5-trioxa-2a1-azacyclopenta[cd]pentalene-2,6-diyl)bis(methylene))bis(3-phenylpropanamide)

ID: ALA5282334

Max Phase: Preclinical

Molecular Formula: C28H35N3O5

Molecular Weight: 493.60

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@]1(CNC(=O)CCc2ccccc2)O[C@H]2CO[C@@H]3N2[C@H]1O[C@@]3(C)CNC(=O)CCc1ccccc1

Standard InChI:  InChI=1S/C28H35N3O5/c1-27(18-29-22(32)15-13-20-9-5-3-6-10-20)25-31-24(17-34-25)35-28(2,26(31)36-27)19-30-23(33)16-14-21-11-7-4-8-12-21/h3-12,24-26H,13-19H2,1-2H3,(H,29,32)(H,30,33)/t24-,25-,26-,27-,28-/m0/s1

Standard InChI Key:  QTYZCCNGUMNJSH-XLIKFSOKSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   -0.5374    0.7009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0418    1.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2425    0.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0437    0.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5142    1.4258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0056    2.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5755    2.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2171    1.8116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1220    3.0154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6876    2.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3192   -0.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8684    1.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4614    0.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6198    0.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7219    2.4983    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2425    0.1498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1605    2.6339    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1415   -0.1849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3050    2.0362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4213   -0.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2395   -1.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8830   -1.6008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1359    2.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5259    1.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5767    2.7145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3647    1.2481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5187   -1.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7588    0.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3438   -2.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5956    0.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9897   -0.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5448   -0.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7018   -0.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3116   -0.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6187   -2.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4429   -3.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9897   -2.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7065   -1.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8829   -1.4324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  2  1  0
  3  8  1  0
  6  8  1  0
  7  8  1  0
  7  9  1  0
  6 10  1  0
  9 10  1  0
  4 11  1  1
  2 12  1  1
  2 13  1  0
  4 14  1  0
  6 15  1  1
  3 16  1  1
  7 17  1  1
 11 18  1  0
 12 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  2  0
 19 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 21 27  1  0
 26 28  1  0
 27 29  1  0
 28 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 28  1  0
 29 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282334

    ---

Associated Targets(Human)

HCRTR2 Tclin Orexin receptor 2 (5902 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.60Molecular Weight (Monoisotopic): 493.2577AlogP: 2.37#Rotatable Bonds: 10
Polar Surface Area: 89.13Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.79CX LogD: 3.79
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.53Np Likeness Score: 0.10

References

1. Amezawa M, Yamamoto N, Nagumo Y, Kutsumura N, Ishikawa Y, Yanagisawa M, Nagase H, Saitoh T..  (2023)  Design and synthesis of novel orexin 2 receptor agonists with a 1,3,5‑trioxazatriquinane skeleton.,  82  [PMID:36690040] [10.1016/j.bmcl.2023.129151]

Source