The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(cyclopropanecarbonylamino)-4-[3-[[4-(1-ethyl-1,2,4-triazol-3-yl)phenyl]carbamoyl]-2-methoxy-anilino]-N-(trideuteriomethyl)pyridazine-3-carboxamide ID: ALA5282377
Max Phase: Preclinical
Molecular Formula: C28H29N9O4
Molecular Weight: 555.60
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(C(=O)Nc2ccc(-c3ncn(CC)n3)cc2)c1OC
Standard InChI: InChI=1S/C28H29N9O4/c1-4-37-15-30-25(36-37)16-10-12-18(13-11-16)31-27(39)19-6-5-7-20(24(19)41-3)32-21-14-22(33-26(38)17-8-9-17)34-35-23(21)28(40)29-2/h5-7,10-15,17H,4,8-9H2,1-3H3,(H,29,40)(H,31,39)(H2,32,33,34,38)/i2D3
Standard InChI Key: FMBUXEJHVWPRAC-BMSJAHLVSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
-1.1168 1.3959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8288 1.8126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5457 1.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1168 0.5709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8433 0.1626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8433 -0.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1361 -1.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1361 -1.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4240 -2.3206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2928 -1.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0048 -2.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8298 -2.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4132 -3.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2928 -1.0873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8529 -2.3122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5601 -1.8956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5601 -1.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2722 -0.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2722 0.1710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9890 -1.0623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7011 -0.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4131 -0.2290 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7011 0.1793 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.4180 -1.0539 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.4096 0.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3072 0.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3072 1.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3999 1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3999 2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3217 3.0376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0337 2.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0337 1.7959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7410 1.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4627 1.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4627 2.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7506 3.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1071 3.0459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1774 1.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8920 1.7875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5108 1.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1801 0.4816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3559 0.5739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5928 -0.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4180 -0.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 11 1 0
13 12 1 0
14 10 2 0
8 15 1 0
15 16 2 0
17 6 2 0
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
4 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 1 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
36 31 2 0
35 36 1 0
29 37 2 0
34 38 1 0
39 38 1 0
39 40 2 0
40 41 1 0
42 41 1 0
38 42 2 0
41 43 1 0
43 44 1 0
M ISO 3 22 2 23 2 24 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.60Molecular Weight (Monoisotopic): 555.2343AlogP: 3.47#Rotatable Bonds: 10Polar Surface Area: 165.05Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.09CX Basic pKa: 3.35CX LogP: 3.51CX LogD: 3.51Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -1.56
References 1. Liu F, Wang B, Liu Y, Shi W, Hu Z, Chang X, Tang X, Zhang Y, Xu H, He Y.. (2023) Design, synthesis and biological evaluation of novel N-(methyl-d3 ) pyridazine-3-carboxamide derivatives as TYK2 inhibitors., 86 [PMID:36907336 ] [10.1016/j.bmcl.2023.129235 ]