The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S)-2-[[(2S)-2-[[(2S)-2-(benzyloxycarbonylamino)-3-phenyl-propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methyl-pentanoic acid ID: ALA5282443
Max Phase: Preclinical
Molecular Formula: C29H35N5O6
Molecular Weight: 549.63
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)O
Standard InChI: InChI=1S/C29H35N5O6/c1-3-19(2)25(28(37)38)34-27(36)24(15-22-16-30-18-31-22)32-26(35)23(14-20-10-6-4-7-11-20)33-29(39)40-17-21-12-8-5-9-13-21/h4-13,16,18-19,23-25H,3,14-15,17H2,1-2H3,(H,30,31)(H,32,35)(H,33,39)(H,34,36)(H,37,38)/t19-,23-,24-,25-/m0/s1
Standard InChI Key: CGWOGZOSEJBONX-KMAVCZJNSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
-3.2173 -0.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5028 0.3288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7881 -0.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 0.3288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3586 -0.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3560 0.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0708 -0.0837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7855 0.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5002 -0.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2150 0.3288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9297 -0.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6444 0.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3592 -0.0837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6444 1.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9297 -0.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6444 -1.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2150 -1.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2150 -2.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5002 -0.9090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7855 1.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5002 1.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5864 2.3872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3933 2.5587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8058 1.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2538 1.2313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3560 1.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3586 -0.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3560 -1.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0709 -0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7831 -1.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7831 -2.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0727 -2.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3560 -2.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7881 -0.9090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9320 0.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6469 -0.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3592 0.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3592 1.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6488 1.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9320 1.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 6
12 13 1 0
12 14 2 0
11 15 1 0
15 16 1 1
15 17 1 0
17 18 1 0
9 19 2 0
8 20 1 1
20 21 1 0
22 21 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
6 26 2 0
5 27 1 6
27 28 1 0
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
3 34 2 0
1 35 1 0
36 35 2 0
37 36 1 0
38 37 2 0
39 38 1 0
40 39 2 0
35 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.63Molecular Weight (Monoisotopic): 549.2587AlogP: 2.59#Rotatable Bonds: 14Polar Surface Area: 162.51Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.76CX Basic pKa: 6.74CX LogP: 1.92CX LogD: 1.17Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -0.17
References 1. Van der Poorten O, Knuhtsen A, Sejer Pedersen D, Ballet S, Tourwé D.. (2016) Side Chain Cyclized Aromatic Amino Acids: Great Tools as Local Constraints in Peptide and Peptidomimetic Design., 59 (24): [PMID:27690430 ] [10.1021/acs.jmedchem.6b01029 ]