N'-(4-chlorobenzylidene)-2-((3,6-dimethyl-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)oxy)acetohydrazide

ID: ALA5282466

Max Phase: Preclinical

Molecular Formula: C22H19ClN6O2

Molecular Weight: 434.89

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(OCC(=O)N/N=C/c2ccc(Cl)cc2)c2c(C)nn(-c3ccccc3)c2n1

Standard InChI:  InChI=1S/C22H19ClN6O2/c1-14-20-21(29(28-14)18-6-4-3-5-7-18)25-15(2)26-22(20)31-13-19(30)27-24-12-16-8-10-17(23)11-9-16/h3-12H,13H2,1-2H3,(H,27,30)/b24-12+

Standard InChI Key:  AFGAOJIQXSWXHT-WYMPLXKRSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    1.1408    0.9086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8554    1.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5674    0.9091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5674    0.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8572   -0.3279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1408    0.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3521   -0.1710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3521    1.1640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8371    0.4963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8554    2.1462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1408    2.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5657    1.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4263   -0.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5657   -0.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3627   -1.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5749   -1.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9912   -2.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1977   -2.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9797   -1.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4262    2.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2884    2.5587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4262    1.3209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0030    2.1462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7176    2.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4323    2.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4325    1.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1454    0.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8602    1.3229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8618    2.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1500    2.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5749    0.9103    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  2 10  1  0
 10 11  1  0
  8 12  1  0
  6 13  1  0
 14  7  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 14 19  1  0
 19 18  2  0
 11 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282466

    ---

Associated Targets(Human)

FGFR3 Tclin Fibroblast growth factor receptor (331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.89Molecular Weight (Monoisotopic): 434.1258AlogP: 3.61#Rotatable Bonds: 6
Polar Surface Area: 94.29Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.57CX Basic pKa: 1.99CX LogP: 4.26CX LogD: 4.26
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -2.26

References

1. Liu FT, Li NG, Zhang YM, Xie WC, Yang SP, Lu T, Shi ZH..  (2020)  Recent advance in the development of novel, selective and potent FGFR inhibitors.,  186  [PMID:31761386] [10.1016/j.ejmech.2019.111884]

Source