(S)-8-(4-(methylthio)phenyl)-6-oxo-3-(o-tolyl)-2,3,4,6,7,8-hexahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile

ID: ALA5282498

Max Phase: Preclinical

Molecular Formula: C22H21N3OS2

Molecular Weight: 407.56

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1ccc([C@@H]2CC(=O)N3CN(c4ccccc4C)CSC3=C2C#N)cc1

Standard InChI:  InChI=1S/C22H21N3OS2/c1-15-5-3-4-6-20(15)24-13-25-21(26)11-18(19(12-23)22(25)28-14-24)16-7-9-17(27-2)10-8-16/h3-10,18H,11,13-14H2,1-2H3/t18-/m0/s1

Standard InChI Key:  BPUPYESOOCJFSB-SFHVURJKSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -1.7935   -0.7910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780    0.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0559    0.4327    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3493    0.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3648   -0.8179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0869   -1.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3726    0.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0793   -0.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0637   -0.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3416   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8012    0.3786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8168    1.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5371    1.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2435    1.1742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2296    0.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5106   -0.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5154   -1.1897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5311   -2.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2513   -2.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9578   -1.9854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9439   -1.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2248   -0.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3883    1.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4039    2.0549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3260   -2.0684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2092    0.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9578    1.5866    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.9578    2.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  4  7  2  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  5 10  1  0
  8 11  1  6
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 11 16  1  0
 16 15  2  0
 17  1  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 17 22  1  0
 22 21  2  0
  7 23  1  0
 23 24  3  0
 10 25  2  0
 22 26  1  0
 14 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282498

    ---

Associated Targets(Human)

PIP4K2A Tbio Phosphatidylinositol-5-phosphate 4-kinase type-2 alpha (1501 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CG Tclin PI3-kinase p110-gamma subunit (5411 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.56Molecular Weight (Monoisotopic): 407.1126AlogP: 4.94#Rotatable Bonds: 3
Polar Surface Area: 47.34Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.00CX LogD: 5.00
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.67Np Likeness Score: -1.68

References

1. Willems HMG, Edwards S, Boffey HK, Chawner SJ, Green C, Romero T, Winpenny D, Skidmore J, Clarke JH, Andrews SP..  (2023)  Identification of ARUK2002821 as an isoform-selective PI5P4Kα inhibitor.,  14  (5): [PMID:37252102] [10.1039/d3md00039g]

Source