Hyrtimomine D

ID: ALA5282549

Max Phase: Preclinical

Molecular Formula: C28H24N5O3S+

Molecular Weight: 510.60

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1c(C2=C(c3c[nH]c4ccc(O)cc34)C(=O)N3c4ccc(O)cc4C4C=CN=C2C43)n(C)c[n+]1C

Standard InChI:  InChI=1S/C28H23N5O3S/c1-31-13-32(2)28(37-3)26(31)23-22(19-12-30-20-6-4-14(34)10-17(19)20)27(36)33-21-7-5-15(35)11-18(21)16-8-9-29-24(23)25(16)33/h4-13,16,25H,1-3H3,(H2-,29,30,34,35,36)/p+1

Standard InChI Key:  JGNZGZNPEOROQF-UHFFFAOYSA-O

Molfile:  

 
     RDKit          2D

 37 43  0  0  0  0  0  0  0  0999 V2000
    0.5410   -1.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1515   -1.2902    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0960   -0.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3745   -0.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3468   -0.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3468   -1.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0128   -1.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8452   -1.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4001   -2.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0384   -2.0949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1504   -3.0383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3180   -3.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7630   -2.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0693   -2.5666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3190   -1.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0682   -0.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0682    0.7630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3468    1.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5133    2.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3457    2.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8452    2.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6776    2.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0661    3.2048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0106    1.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5111    1.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7065    1.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1227    2.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9270    2.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0945    1.3661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3745    0.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6509   -0.4023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8452   -0.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0117    0.6797    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.5122    1.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4001   -0.7630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0661   -0.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9839   -1.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  7  6  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13  7  2  0
 14 13  1  0
 15 14  1  0
  6 15  2  0
  5 16  1  0
 16 17  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 20  2  0
 17 26  1  0
 19 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 18 30  1  0
  4 30  1  0
 16 31  2  0
 32  3  2  0
 32 33  1  0
 33 34  1  0
 35 32  1  0
 35 36  1  0
 37 35  2  0
  2 37  1  0
M  CHG  1  35   1
M  END

Alternative Forms

  1. Parent:

    ALA5282549

    ---

Associated Targets(non-human)

Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cryptococcus neoformans (21258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus aureus (210822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 510.60Molecular Weight (Monoisotopic): 510.1594AlogP: 3.86#Rotatable Bonds: 3
Polar Surface Area: 97.73Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.08CX Basic pKa: 5.03CX LogP: -0.30CX LogD: -0.31
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: 0.70

References

1. Dai J, Dan W, Schneider U, Wang J..  (2018)  β-Carboline alkaloid monomers and dimers: Occurrence, structural diversity, and biological activities.,  157  [PMID:30125723] [10.1016/j.ejmech.2018.08.027]

Source