The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Hyrtimomine D ID: ALA5282549
Max Phase: Preclinical
Molecular Formula: C28H24N5O3S+
Molecular Weight: 510.60
Associated Items:
Names and Identifiers Canonical SMILES: CSc1c(C2=C(c3c[nH]c4ccc(O)cc34)C(=O)N3c4ccc(O)cc4C4C=CN=C2C43)n(C)c[n+]1C
Standard InChI: InChI=1S/C28H23N5O3S/c1-31-13-32(2)28(37-3)26(31)23-22(19-12-30-20-6-4-14(34)10-17(19)20)27(36)33-21-7-5-15(35)11-18(21)16-8-9-29-24(23)25(16)33/h4-13,16,25H,1-3H3,(H2-,29,30,34,35,36)/p+1
Standard InChI Key: JGNZGZNPEOROQF-UHFFFAOYSA-O
Molfile:
RDKit 2D
37 43 0 0 0 0 0 0 0 0999 V2000
0.5410 -1.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1515 -1.2902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0960 -0.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3745 -0.0693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3468 -0.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3468 -1.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0128 -1.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8452 -1.6232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4001 -2.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0384 -2.0949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1504 -3.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3180 -3.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7630 -2.5666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0693 -2.5666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3190 -1.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0682 -0.0693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0682 0.7630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3468 1.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5133 2.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3457 2.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8452 2.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6776 2.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0661 3.2048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0106 1.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5111 1.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7065 1.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1227 2.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9270 2.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0945 1.3661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3745 0.7630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6509 -0.4023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8452 -0.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0117 0.6797 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.5122 1.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4001 -0.7630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0661 -0.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9839 -1.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 1 0
4 5 2 0
5 6 1 0
7 6 1 0
7 8 1 0
8 9 2 0
9 10 1 0
9 11 1 0
11 12 2 0
12 13 1 0
13 7 2 0
14 13 1 0
15 14 1 0
6 15 2 0
5 16 1 0
16 17 1 0
18 17 1 0
19 18 1 0
20 19 1 0
20 21 1 0
21 22 2 0
22 23 1 0
22 24 1 0
24 25 2 0
25 26 1 0
26 20 2 0
17 26 1 0
19 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
18 30 1 0
4 30 1 0
16 31 2 0
32 3 2 0
32 33 1 0
33 34 1 0
35 32 1 0
35 36 1 0
37 35 2 0
2 37 1 0
M CHG 1 35 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.60Molecular Weight (Monoisotopic): 510.1594AlogP: 3.86#Rotatable Bonds: 3Polar Surface Area: 97.73Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.08CX Basic pKa: 5.03CX LogP: -0.30CX LogD: -0.31Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: 0.70
References 1. Dai J, Dan W, Schneider U, Wang J.. (2018) β-Carboline alkaloid monomers and dimers: Occurrence, structural diversity, and biological activities., 157 [PMID:30125723 ] [10.1016/j.ejmech.2018.08.027 ]