N-(4-(7-(1-acetyl-1,2,3,6-tetrahydropyridin-4-yl)imidazo[1,2-a]pyridin-3-yl)phenyl)-5-nitrofuran-2-carboxamide

ID: ALA5282555

Max Phase: Preclinical

Molecular Formula: C25H21N5O5

Molecular Weight: 471.47

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N1CC=C(c2ccn3c(-c4ccc(NC(=O)c5ccc([N+](=O)[O-])o5)cc4)cnc3c2)CC1

Standard InChI:  InChI=1S/C25H21N5O5/c1-16(31)28-11-8-17(9-12-28)19-10-13-29-21(15-26-23(29)14-19)18-2-4-20(5-3-18)27-25(32)22-6-7-24(35-22)30(33)34/h2-8,10,13-15H,9,11-12H2,1H3,(H,27,32)

Standard InChI Key:  VLRJSYPGGVKGLV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    6.4829   -0.3883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0704   -1.1027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4829   -1.8172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2454   -1.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8330   -1.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0264   -1.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9402   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6935   -0.4899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2256   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2256    0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5112   -0.8253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7966   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0863   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3696   -0.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3696    0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3453    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4315    1.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2387    1.8172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6512    1.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4618    0.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7118    0.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5087   -0.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0921    0.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8891    0.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1025   -0.4963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5192   -1.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7223   -0.8661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8995   -0.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1130   -1.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4829   -0.1264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1610   -0.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3537   -0.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0991    0.4894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0845    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7966    0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  8  4  1  0
  8  7  1  0
  9  7  1  0
  9 10  2  0
 11  9  1  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 19 20  1  0
 20 21  2  0
 22 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 22 27  1  0
 25 28  1  0
 28 29  1  0
 28 30  2  0
 21 31  1  0
 31 32  2  0
 33 32  1  0
 33 19  1  0
 16 33  1  0
 34 15  2  0
 12 35  2  0
 35 34  1  0
M  CHG  2   2   1   3  -1
M  END

Alternative Forms

  1. Parent:

    ALA5282555

    ---

Associated Targets(Human)

AGS (1999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.47Molecular Weight (Monoisotopic): 471.1543AlogP: 4.39#Rotatable Bonds: 5
Polar Surface Area: 122.99Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.62CX Basic pKa: 5.88CX LogP: 2.11CX LogD: 2.10
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -1.55

References

1. Li H, Ouyang S, Zhang Y, Peng K, Fang W, Liu Z, Wang CY, Zhang X, Wang Y..  (2022)  Structural optimization of Imidazo[1, 2-a]pyridine derivatives for the treatment of gastric cancer via STAT3 signaling pathway.,  244  [PMID:36283181] [10.1016/j.ejmech.2022.114858]

Source