The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-2-[4-[[1-Adamantanecarbonyl]-1-piperazinyl]-2-oxoethyl]chlorofluoroacetamide ID: ALA5282572
Max Phase: Preclinical
Molecular Formula: C19H27ClFN3O3
Molecular Weight: 399.89
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCC(=O)N1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)CC1)C(F)Cl
Standard InChI: InChI=1S/C19H27ClFN3O3/c20-16(21)17(26)22-11-15(25)23-1-3-24(4-2-23)18(27)19-8-12-5-13(9-19)7-14(6-12)10-19/h12-14,16H,1-11H2,(H,22,26)
Standard InChI Key: XWALABJLJRYGAC-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
-2.3931 -1.6073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5681 -1.6073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1556 -0.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3307 -0.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0817 -1.6073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0817 -0.1784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9066 -0.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3191 0.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9066 1.2503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0817 1.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3307 0.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3191 1.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9066 2.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 1.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4910 1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3104 1.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3104 2.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8746 3.0362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6306 2.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6306 1.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0771 1.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8688 1.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8056 -2.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3931 -3.0362 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6306 -2.3218 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.8056 -0.8929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
4 5 2 0
6 4 1 0
7 6 1 0
7 8 1 0
8 9 1 0
9 10 1 0
6 11 1 0
11 10 1 0
12 9 1 0
12 13 2 0
14 12 1 0
14 15 1 0
16 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 19 1 0
21 16 1 0
20 21 1 0
22 20 1 0
14 22 1 0
14 23 1 0
18 23 1 0
1 24 1 0
24 25 1 0
24 26 1 0
1 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.89Molecular Weight (Monoisotopic): 399.1725AlogP: 1.52#Rotatable Bonds: 4Polar Surface Area: 69.72Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.04CX Basic pKa: 1.17CX LogP: 0.84CX LogD: 0.83Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.73Np Likeness Score: -1.11
References 1. Mader L, Watt SKI, Iyer HR, Nguyen L, Kaur H, Keillor JW.. (2023) The war on hTG2: warhead optimization in small molecule human tissue transglutaminase inhibitors., 14 (2.0): [PMID:36846370 ] [10.1039/d2md00378c ]