The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dimethyl 4-(3-((2-((3-(4-(3-methoxyphenyl)piperidin-1-yl)propyl)amino)-3,4-dioxocyclobut-1-en-1-yl)amino)phenyl)-2-methyl-1,4-dihydropyridine-3,5-dicarboxylate ID: ALA5282574
Max Phase: Preclinical
Molecular Formula: C35H40N4O7
Molecular Weight: 628.73
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=CNC(C)=C(C(=O)OC)C1c1cccc(Nc2c(NCCCN3CCC(c4cccc(OC)c4)CC3)c(=O)c2=O)c1
Standard InChI: InChI=1S/C35H40N4O7/c1-21-28(35(43)46-4)29(27(20-37-21)34(42)45-3)24-9-5-10-25(18-24)38-31-30(32(40)33(31)41)36-14-7-15-39-16-12-22(13-17-39)23-8-6-11-26(19-23)44-2/h5-6,8-11,18-20,22,29,36-38H,7,12-17H2,1-4H3
Standard InChI Key: QFMXASBYTCQRHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 50 0 0 0 0 0 0 0 0999 V2000
-0.8430 -3.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5575 -3.5877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2719 -3.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9865 -3.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9873 -4.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7024 -4.8237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.4146 -4.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4194 -3.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7013 -3.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7013 -2.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4180 -1.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4180 -1.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7031 -0.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9910 -1.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9910 -1.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2760 -0.6988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1339 -3.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8484 -3.5892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.8484 -4.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1339 -2.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2727 -4.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2719 -2.3501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5615 -1.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7509 -0.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5374 -1.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3479 -1.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3385 -0.1797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4865 -0.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7604 -2.6229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1770 -2.1037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8990 0.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7240 0.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1366 1.2492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7240 1.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1366 2.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9616 2.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3742 1.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9616 1.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3742 3.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9618 4.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3737 4.8193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1991 4.8193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6108 4.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2028 3.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4359 4.1092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8484 4.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 1 0
8 7 2 0
4 9 1 0
9 8 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
10 15 1 0
15 14 2 0
14 16 1 0
8 17 1 0
17 18 1 0
18 19 1 0
17 20 2 0
5 21 1 0
3 22 2 0
16 23 1 0
24 23 2 0
25 24 1 0
25 26 1 0
26 23 1 0
24 27 1 0
27 28 1 0
26 29 2 0
25 30 2 0
28 31 1 0
31 32 1 0
32 33 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 1 0
38 37 1 0
33 38 1 0
39 36 1 0
40 39 2 0
41 40 1 0
42 41 2 0
43 42 1 0
39 44 1 0
44 43 2 0
43 45 1 0
45 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.73Molecular Weight (Monoisotopic): 628.2897AlogP: 3.91#Rotatable Bonds: 12Polar Surface Area: 135.30Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.28CX Basic pKa: 7.90CX LogP: 3.02CX LogD: 2.40Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.15Np Likeness Score: -0.58
References 1. Ronchetti R, Moroni G, Carotti A, Gioiello A, Camaioni E.. (2021) Recent advances in urea- and thiourea-containing compounds: focus on innovative approaches in medicinal chemistry and organic synthesis., 12 (7.0): [PMID:34355177 ] [10.1039/D1MD00058F ]