The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(Ethyldisulfaneyl)-N-(2-oxo-2-((3-phenoxyphenyl)amino)ethyl)benzamide ID: ALA5282650
Max Phase: Preclinical
Molecular Formula: C23H22N2O3S2
Molecular Weight: 438.57
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCSSc1ccccc1C(=O)NCC(=O)Nc1cccc(Oc2ccccc2)c1
Standard InChI: InChI=1S/C23H22N2O3S2/c1-2-29-30-21-14-7-6-13-20(21)23(27)24-16-22(26)25-17-9-8-12-19(15-17)28-18-10-4-3-5-11-18/h3-15H,2,16H2,1H3,(H,24,27)(H,25,26)
Standard InChI Key: QSCACXQKJOBMEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-4.6411 -3.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9266 -2.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9266 -2.0602 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.2121 -1.6477 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.2121 -0.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9283 -0.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9283 0.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2139 0.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5022 0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5022 -0.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7877 -0.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7877 -1.6485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0732 -0.4109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3588 -0.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3556 -0.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0700 -0.8235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7845 -0.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5019 -0.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2136 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2136 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4974 0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4974 1.6495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2119 2.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9294 1.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6411 2.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6411 2.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9248 3.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2119 2.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7845 0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3556 0.4139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 2 0
7 6 1 0
8 7 2 0
9 8 1 0
10 9 2 0
5 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 23 2 0
21 29 1 0
29 17 2 0
15 30 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.57Molecular Weight (Monoisotopic): 438.1072AlogP: 5.61#Rotatable Bonds: 9Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.05CX Basic pKa: ┄CX LogP: 4.78CX LogD: 4.78Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -1.30
References 1. Sapra R, Rajora AK, Kumar P, Maurya GP, Pant N, Haridas V.. (2021) Chemical Biology of Sortase A Inhibition: A Gateway to Anti-infective Therapeutic Agents., 64 (18.0): [PMID:34516107 ] [10.1021/acs.jmedchem.1c00386 ]