2-(Ethyldisulfaneyl)-N-(2-oxo-2-((3-phenoxyphenyl)amino)ethyl)benzamide

ID: ALA5282650

Max Phase: Preclinical

Molecular Formula: C23H22N2O3S2

Molecular Weight: 438.57

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCSSc1ccccc1C(=O)NCC(=O)Nc1cccc(Oc2ccccc2)c1

Standard InChI:  InChI=1S/C23H22N2O3S2/c1-2-29-30-21-14-7-6-13-20(21)23(27)24-16-22(26)25-17-9-8-12-19(15-17)28-18-10-4-3-5-11-18/h3-15H,2,16H2,1H3,(H,24,27)(H,25,26)

Standard InChI Key:  QSCACXQKJOBMEU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   -4.6411   -3.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9266   -2.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9266   -2.0602    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2121   -1.6477    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2121   -0.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9283   -0.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9283    0.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2139    0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5022    0.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5022   -0.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7877   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7877   -1.6485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0732   -0.4109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3588   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3556   -0.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0700   -0.8235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845   -0.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5019   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136   -0.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4974    0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4974    1.6495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2119    2.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9294    1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6411    2.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6411    2.8849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9248    3.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2119    2.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845    0.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3556    0.4139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  5 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 23  2  0
 21 29  1  0
 29 17  2  0
 15 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5282650

    ---

Associated Targets(non-human)

srtA Sortase A (641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 438.57Molecular Weight (Monoisotopic): 438.1072AlogP: 5.61#Rotatable Bonds: 9
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.05CX Basic pKa: CX LogP: 4.78CX LogD: 4.78
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -1.30

References

1. Sapra R, Rajora AK, Kumar P, Maurya GP, Pant N, Haridas V..  (2021)  Chemical Biology of Sortase A Inhibition: A Gateway to Anti-infective Therapeutic Agents.,  64  (18.0): [PMID:34516107] [10.1021/acs.jmedchem.1c00386]

Source