The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-amino-5-(3-chlorophenyl)-6-cyano-2-[(4-methoxyphenyl)amino]-N-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide ID: ALA5282721
Max Phase: Preclinical
Molecular Formula: C27H20ClN7O2
Molecular Weight: 509.96
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Nc2nn3c(N)c(C#N)c(-c4cccc(Cl)c4)nc3c2C(=O)Nc2ccccc2)cc1
Standard InChI: InChI=1S/C27H20ClN7O2/c1-37-20-12-10-19(11-13-20)31-25-22(27(36)32-18-8-3-2-4-9-18)26-33-23(16-6-5-7-17(28)14-16)21(15-29)24(30)35(26)34-25/h2-14H,30H2,1H3,(H,31,34)(H,32,36)
Standard InChI Key: IMKVTKKWANCRPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-0.2687 0.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4457 0.5856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1601 0.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1601 -0.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4457 -1.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2687 -0.6518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 -0.9019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5433 -0.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0514 0.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4457 -1.8890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8743 -1.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5885 -1.4764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2648 1.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0614 1.4290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6817 1.7987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3680 -0.2484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7803 -0.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2749 2.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0714 2.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2835 3.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7002 3.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9071 3.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6892 2.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3681 -1.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7799 -2.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6048 -2.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0165 -1.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6085 -0.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0172 -3.1028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6048 -3.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8743 0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8746 1.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5870 1.8206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3014 1.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3030 0.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5915 0.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0172 0.1753 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
4 3 1 0
5 4 2 0
1 6 1 0
6 5 1 0
6 7 1 0
7 8 2 0
9 8 1 0
1 9 2 0
5 10 1 0
4 11 1 0
11 12 3 0
9 13 1 0
13 14 1 0
13 15 2 0
8 16 1 0
16 17 1 0
14 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
24 17 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
17 28 1 0
26 29 1 0
29 30 1 0
31 3 1 0
32 31 2 0
33 32 1 0
34 33 2 0
35 34 1 0
31 36 1 0
36 35 2 0
35 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.96Molecular Weight (Monoisotopic): 509.1367AlogP: 5.51#Rotatable Bonds: 6Polar Surface Area: 130.36Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.55CX Basic pKa: 1.54CX LogP: 6.68CX LogD: 6.68Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -1.64
References 1. Hammouda MM, Gaffer HE, Elattar KM.. (2022) Insights into the medicinal chemistry of heterocycles integrated with a pyrazolo[1,5-a ]pyrimidine scaffold., 13 (10.0): [PMID:36325400 ] [10.1039/d2md00192f ]