7-amino-5-(3-chlorophenyl)-6-cyano-2-[(4-methoxyphenyl)amino]-N-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide

ID: ALA5282721

Max Phase: Preclinical

Molecular Formula: C27H20ClN7O2

Molecular Weight: 509.96

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Nc2nn3c(N)c(C#N)c(-c4cccc(Cl)c4)nc3c2C(=O)Nc2ccccc2)cc1

Standard InChI:  InChI=1S/C27H20ClN7O2/c1-37-20-12-10-19(11-13-20)31-25-22(27(36)32-18-8-3-2-4-9-18)26-33-23(16-6-5-7-17(28)14-16)21(15-29)24(30)35(26)34-25/h2-14H,30H2,1H3,(H,31,34)(H,32,36)

Standard InChI Key:  IMKVTKKWANCRPC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -0.2687    0.1731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4457    0.5856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1601    0.1731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1601   -0.6518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4457   -1.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2687   -0.6518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0726   -0.9019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5433   -0.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0514    0.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4457   -1.8890    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8743   -1.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5885   -1.4764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2648    1.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0614    1.4290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6817    1.7987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3680   -0.2484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7803   -0.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2749    2.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0714    2.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2835    3.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7002    3.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9071    3.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6892    2.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3681   -1.6770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7799   -2.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6048   -2.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0165   -1.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6085   -0.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0172   -3.1028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6048   -3.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8743    0.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8746    1.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5870    1.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3014    1.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3030    0.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5915    0.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0172    0.1753    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  6  7  1  0
  7  8  2  0
  9  8  1  0
  1  9  2  0
  5 10  1  0
  4 11  1  0
 11 12  3  0
  9 13  1  0
 13 14  1  0
 13 15  2  0
  8 16  1  0
 16 17  1  0
 14 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 24 17  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 17 28  1  0
 26 29  1  0
 29 30  1  0
 31  3  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 35 34  1  0
 31 36  1  0
 36 35  2  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282721

    ---

Associated Targets(non-human)

Aspergillus niger (16508 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.96Molecular Weight (Monoisotopic): 509.1367AlogP: 5.51#Rotatable Bonds: 6
Polar Surface Area: 130.36Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.55CX Basic pKa: 1.54CX LogP: 6.68CX LogD: 6.68
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -1.64

References

1. Hammouda MM, Gaffer HE, Elattar KM..  (2022)  Insights into the medicinal chemistry of heterocycles integrated with a pyrazolo[1,5-a]pyrimidine scaffold.,  13  (10.0): [PMID:36325400] [10.1039/d2md00192f]

Source