Butyl 6-(4-(2-(3,4-dichlorophenyl)acetyl)piperazin-1-yl)imidazo[1,2-b]pyridazine-2-carboxylate

ID: ALA5282795

Max Phase: Preclinical

Molecular Formula: C23H25Cl2N5O3

Molecular Weight: 490.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)c1cn2nc(N3CCN(C(=O)Cc4ccc(Cl)c(Cl)c4)CC3)ccc2n1

Standard InChI:  InChI=1S/C23H25Cl2N5O3/c1-2-3-12-33-23(32)19-15-30-20(26-19)6-7-21(27-30)28-8-10-29(11-9-28)22(31)14-16-4-5-17(24)18(25)13-16/h4-7,13,15H,2-3,8-12,14H2,1H3

Standard InChI Key:  GTFJCKJHWJKRAY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    1.7314   -0.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3191   -0.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4946   -0.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0824   -0.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4946    0.6733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3191    0.6733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8688    1.2779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6383    0.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5558    0.1236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3528    1.3602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3528    2.1849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0674    0.9481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7819    1.3602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4965    0.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2111    1.3602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9256    0.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7420   -0.0412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1541   -0.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9787   -0.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3910   -0.0412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9787    0.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1541    0.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2155   -0.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6277    0.6733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6277   -0.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4522   -0.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8644   -1.4703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6889   -1.4703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1012   -0.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6889   -0.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8644   -0.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9256   -0.7557    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.1012   -2.1849    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  1  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
  9  1  2  0
  8 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  4 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 22  1  0
 20 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 26 31  2  0
 29 32  1  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282795

    ---

Associated Targets(non-human)

Cryptosporidium parvum (1150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.39Molecular Weight (Monoisotopic): 489.1334AlogP: 3.88#Rotatable Bonds: 7
Polar Surface Area: 80.04Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.62CX LogP: 4.99CX LogD: 4.99
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.85

References

1. Oboh E, Teixeira JE, Schubert TJ, Maribona AS, Denman BN, Patel R, Huston CD, Meyers MJ..  (2023)  Structure-Activity relationships of replacements for the triazolopyridazine of Anti-Cryptosporidium lead SLU-2633.,  86  [PMID:37148788] [10.1016/j.bmc.2023.117295]

Source