(2S)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]-N-propyl-2-(3,3,3-trifluoropropyl)butanediamide

ID: ALA5282809

Max Phase: Preclinical

Molecular Formula: C26H29F3N4O3

Molecular Weight: 502.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCNC(=O)[C@@H](CCC(F)(F)F)CC(=O)N[C@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O

Standard InChI:  InChI=1S/C26H29F3N4O3/c1-3-15-30-24(35)18(13-14-26(27,28)29)16-21(34)31-23-25(36)33(2)20-12-8-7-11-19(20)22(32-23)17-9-5-4-6-10-17/h4-12,18,23H,3,13-16H2,1-2H3,(H,30,35)(H,31,34)/t18-,23-/m0/s1

Standard InChI Key:  KNMXJTRRYFYOMO-MBSDFSHPSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   -4.5090   -0.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7943    0.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0822   -0.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0822   -0.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7924   -1.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5090   -0.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4279   -1.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6218   -1.2273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2681   -0.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6355    0.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4397    0.4410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6532    1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0519    0.8482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4428   -0.4809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0302    0.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7951    0.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2079    0.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0332    0.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4458    1.6631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4458    0.2336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4428    0.9484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6414   -2.2150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0580   -2.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2716   -3.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0692   -3.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6510   -3.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4421   -2.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2711    1.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6837    2.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5090    2.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7952    1.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2079    2.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7952    3.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2079    3.8072    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0300    3.0924    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.3826    3.8072    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  7  8  2  0
  9  8  1  0
 10  9  1  0
  3 11  1  0
 11 10  1  0
 11 12  1  0
 10 13  2  0
  9 14  1  1
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 15 21  2  0
  7 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 19 28  1  0
 28 29  1  0
 29 30  1  0
 17 31  1  6
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282809

    ---

Associated Targets(non-human)

Cryptosporidium parvum (1150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.54Molecular Weight (Monoisotopic): 502.2192AlogP: 3.82#Rotatable Bonds: 9
Polar Surface Area: 90.87Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.24CX Basic pKa: 0.44CX LogP: 3.64CX LogD: 3.64
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: -0.31

References

1. Lee S, Love MS, Modukuri R, Chatterjee AK, Huerta L, Lawson AP, McNamara CW, Mead JR, Hedstrom L, Cuny GD..  (2023)  Structure-activity relationship of BMS906024 derivatives for Cryptosporidium parvum growth inhibition.,  90  [PMID:37196868] [10.1016/j.bmcl.2023.129328]

Source