4-(2-(2-Benzenesulfonamidophenyl)ethynyl)benzoic Acid

ID: ALA5282855

Max Phase: Preclinical

Molecular Formula: C21H15NO4S

Molecular Weight: 377.42

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(C#Cc2ccccc2NS(=O)(=O)c2ccccc2)cc1

Standard InChI:  InChI=1S/C21H15NO4S/c23-21(24)18-14-11-16(12-15-18)10-13-17-6-4-5-9-20(17)22-27(25,26)19-7-2-1-3-8-19/h1-9,11-12,14-15,22H,(H,23,24)

Standard InChI Key:  RDLIIFRLEDXCGM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   16.1619   -1.2649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5766   -1.9781    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.9869   -1.2624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6117   -1.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6105   -2.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3219   -2.8142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0348   -2.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0320   -1.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3201   -1.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7465   -2.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4582   -3.2217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1699   -3.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1694   -4.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8802   -4.8599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5915   -4.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5876   -3.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8762   -3.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8715   -2.3963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2934   -2.3879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2946   -3.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0107   -3.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7251   -3.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7189   -2.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0023   -1.9690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8994   -1.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8992   -0.3528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1885   -1.5846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  3  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 17 18  1  0
 18  2  1  0
  2 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 25 26  1  0
 25 27  2  0
  4 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282855

    ---

Associated Targets(Human)

SLC16A3 Tchem Monocarboxylate transporter 4 (196 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 377.42Molecular Weight (Monoisotopic): 377.0722AlogP: 3.59#Rotatable Bonds: 4
Polar Surface Area: 83.47Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.21CX Basic pKa: CX LogP: 4.24CX LogD: 0.95
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.68Np Likeness Score: -1.14

References

1. Heinrich T, Sala-Hojman A, Ferretti R, Petersson C, Minguzzi S, Gondela A, Ramaswamy S, Bartosik A, Czauderna F, Crowley L, Wahra P, Schilke H, Böpple P, Dudek Ł, Leś M, Niedziejko P, Olech K, Pawlik H, Włoszczak Ł, Zuchowicz K, Suarez Alvarez JR, Martyka J, Sitek E, Mikulski M, Szczęśniak J, Jäckel S, Krier M, Król M, Wegener A, Gałęzowski M, Nowak M, Becker F, Herhaus C..  (2021)  Discovery of 5-{2-[5-Chloro-2-(5-ethoxyquinoline-8-sulfonamido)phenyl]ethynyl}-4-methoxypyridine-2-carboxylic Acid, a Highly Selective in Vivo Useable Chemical Probe to Dissect MCT4 Biology.,  64  (16.0): [PMID:34382802] [10.1021/acs.jmedchem.1c00448]

Source