(6S)-N-benzyl-6-(4-hydroxybenzyl)-8-(naphthalen-1-ylmethyl)-4-oxohexahydro-2H-pyrazino[1,2-a]pyrimidine-1(6H)-carboxamide

ID: ALA5282882

Max Phase: Preclinical

Molecular Formula: C33H34N4O3

Molecular Weight: 534.66

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCc1ccccc1)N1CCC(=O)N2C1CN(Cc1cccc3ccccc13)C[C@@H]2Cc1ccc(O)cc1

Standard InChI:  InChI=1S/C33H34N4O3/c38-29-15-13-24(14-16-29)19-28-22-35(21-27-11-6-10-26-9-4-5-12-30(26)27)23-31-36(18-17-32(39)37(28)31)33(40)34-20-25-7-2-1-3-8-25/h1-16,28,31,38H,17-23H2,(H,34,40)/t28-,31?/m0/s1

Standard InChI Key:  KDRPMFHUQNHYGE-NPHAVVRNSA-N

Molfile:  

 
     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   -4.2694    2.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2694    2.0487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5560    1.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8490    2.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8490    2.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5578    3.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1374    1.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257    2.0524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7142    1.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0025    2.0524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7142    0.8198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0025    0.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0025   -0.4126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7142   -0.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257    0.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7142   -1.6451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7089   -0.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4206   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4206    0.4090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7090    0.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1322    0.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1322    1.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4214    2.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4214    2.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1333    3.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8469    2.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8469    2.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5635    1.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2694    2.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2694    2.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5490    3.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7089   -1.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4206   -2.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1323   -1.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8415   -2.0555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8415   -2.8775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1342   -3.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4206   -2.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5530   -3.2884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 11 16  1  0
 14 17  2  0
 13 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 12 21  1  0
 20 22  1  0
 22 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 27 32  1  0
 18 33  1  6
 33 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 34 39  1  0
 37 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282882

    ---

Associated Targets(Human)

SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.66Molecular Weight (Monoisotopic): 534.2631AlogP: 4.74#Rotatable Bonds: 6
Polar Surface Area: 76.12Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.51CX Basic pKa: 7.32CX LogP: 4.87CX LogD: 4.60
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.37Np Likeness Score: -0.71

References

1. Phull MS, Jadav SS, Gundla R, Mainkar PS..  (2021)  A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors.,  212  [PMID:33445154] [10.1016/j.ejmech.2020.113149]

Source