The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N1-((2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl)-2-((S)-2-((S)-2-amino-5-guanidinopentanamido)-5-guanidinopentanamido)pentanediamide ID: ALA5282938
Max Phase: Preclinical
Molecular Formula: C23H46N12O5
Molecular Weight: 570.70
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCNC(=N)N)C(N)=O
Standard InChI: InChI=1S/C23H46N12O5/c1-3-12(2)17(18(26)37)35-21(40)15(8-9-16(25)36)34-20(39)14(7-5-11-32-23(29)30)33-19(38)13(24)6-4-10-31-22(27)28/h12-15,17H,3-11,24H2,1-2H3,(H2,25,36)(H2,26,37)(H,33,38)(H,34,39)(H,35,40)(H4,27,28,31)(H4,29,30,32)/t12-,13-,14-,15-,17-/m0/s1
Standard InChI Key: KVBYOLYKARPVJR-BWJWTDLKSA-N
Molfile:
RDKit 2D
40 39 0 0 0 0 0 0 0 0999 V2000
31.2539 -23.2698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2539 -22.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5404 -22.0354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9675 -22.0354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1132 -26.1568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8268 -25.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5404 -26.9810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5404 -26.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8268 -24.9183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5404 -24.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5404 -23.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3947 -28.6295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3947 -29.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6811 -29.8639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1084 -29.8639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2539 -25.7426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9675 -26.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6811 -24.9183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6811 -25.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9675 -26.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6811 -27.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6811 -28.2154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3947 -26.1568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1084 -25.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8219 -26.9810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8219 -26.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1084 -24.9183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8219 -24.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8219 -23.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5354 -23.2698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1084 -23.2698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5354 -25.7426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2491 -26.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9626 -24.9183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9626 -25.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2491 -26.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9626 -27.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5354 -27.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5354 -28.2154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6762 -26.1568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8 16 1 0
19 23 1 0
26 32 1 0
35 40 1 0
1 2 1 0
2 3 1 0
2 4 2 0
5 6 1 0
6 8 1 0
8 7 2 0
6 9 1 1
9 10 1 0
10 11 1 0
11 1 1 0
12 13 1 0
13 14 1 0
13 15 2 0
16 17 1 0
17 19 1 0
19 18 2 0
17 20 1 6
20 21 1 0
21 22 1 0
22 12 1 0
23 24 1 0
24 26 1 0
26 25 2 0
24 27 1 1
27 28 1 0
28 29 1 0
29 30 2 0
29 31 1 0
33 32 1 6
33 35 1 0
35 34 2 0
33 36 1 0
36 37 1 1
36 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.70Molecular Weight (Monoisotopic): 570.3714AlogP: -3.91#Rotatable Bonds: 20Polar Surface Area: 323.30Molecular Species: BASEHBA: 8HBD: 12#RO5 Violations: 2HBA (Lipinski): 17HBD (Lipinski): 17#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.04CX Basic pKa: 11.98CX LogP: -5.22CX LogD: -9.97Aromatic Rings: ┄Heavy Atoms: 40QED Weighted: 0.04Np Likeness Score: 0.18
References 1. Brust A, Croker DE, Colless B, Ragnarsson L, Andersson Å, Jain K, Garcia-Caraballo S, Castro J, Brierley SM, Alewood PF, Lewis RJ.. (2016) Conopeptide-Derived κ-Opioid Agonists (Conorphins): Potent, Selective, and Metabolic Stable Dynorphin A Mimetics with Antinociceptive Properties., 59 (6): [PMID:26859603 ] [10.1021/acs.jmedchem.5b00911 ]