ethyl 4-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-indol-3-yl]acetyl]carbamothioylamino]benzoate

ID: ALA5282951

Max Phase: Preclinical

Molecular Formula: C29H26ClN3O5S

Molecular Weight: 564.06

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(NC(=S)NC(=O)Cc2c(C)n(C(=O)c3ccc(Cl)cc3)c3ccc(OC)cc23)cc1

Standard InChI:  InChI=1S/C29H26ClN3O5S/c1-4-38-28(36)19-7-11-21(12-8-19)31-29(39)32-26(34)16-23-17(2)33(25-14-13-22(37-3)15-24(23)25)27(35)18-5-9-20(30)10-6-18/h5-15H,4,16H2,1-3H3,(H2,31,32,34,39)

Standard InChI Key:  CNWMVFFPTJIZQZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   -2.9446    1.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1196    1.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8694    0.3534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5229   -0.1171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1904    0.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9888    0.1973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5441    0.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3012    1.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5020    1.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0768    0.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5229   -0.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8123   -1.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2336   -1.3480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1014   -0.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3933   -1.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3933   -2.1685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0997   -2.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8123   -2.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3173   -2.5788    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.7093    1.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8887    1.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4784    2.5788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4784    1.1574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3422    1.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7525    0.4467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7525    1.8681    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.5731    0.4467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9836    1.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8018    1.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2122    0.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8053   -0.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9852   -0.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8814    2.1611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6741    1.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0328    0.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4431    1.1564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4431   -0.2649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2638   -0.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6741   -0.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  1  5  2  0
  5  4  1  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
  1  9  1  0
  3 10  1  0
  4 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 12 18  1  0
 16 19  1  0
  2 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
  8 33  1  0
 33 34  1  0
 30 35  1  0
 35 36  2  0
 35 37  1  0
 37 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282951

    ---

Associated Targets(non-human)

PTGS2 Cyclooxygenase-2 (1953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 564.06Molecular Weight (Monoisotopic): 563.1282AlogP: 5.53#Rotatable Bonds: 7
Polar Surface Area: 98.66Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.23CX Basic pKa: CX LogP: 5.87CX LogD: 5.86
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -1.33

References

1. Ahmadi M, Bekeschus S, Weltmann KD, von Woedtke T, Wende K..  (2022)  Non-steroidal anti-inflammatory drugs: recent advances in the use of synthetic COX-2 inhibitors.,  13  (5.0): [PMID:35685617] [10.1039/d1md00280e]

Source