(4-((2-(2,4-dichlorophenoxy)-N-(4-(thiophen-2-yl)thiazol-2-yl)acetamido)methyl)phenyl)sulfamic acid

ID: ALA5282959

Max Phase: Preclinical

Molecular Formula: C22H17Cl2N3O5S3

Molecular Weight: 570.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(COc1ccc(Cl)cc1Cl)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2cccs2)cs1

Standard InChI:  InChI=1S/C22H17Cl2N3O5S3/c23-15-5-8-19(17(24)10-15)32-12-21(28)27(22-25-18(13-34-22)20-2-1-9-33-20)11-14-3-6-16(7-4-14)26-35(29,30)31/h1-10,13,26H,11-12H2,(H,29,30,31)

Standard InChI Key:  WKPWGLNUKDSSLE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    0.7743    1.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0561    1.4773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6546    1.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3727    1.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3801    0.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0983    0.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8090    0.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5272    0.2717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2379    0.6906    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2306    1.5156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8016    1.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0835    1.9090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0487    0.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7816    2.7084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0633    0.6906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4516   -0.1065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4890    1.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7597    0.2333    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.5670   -0.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2352   -0.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5606    0.1026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6478   -1.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2037    1.8834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9215    1.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2352   -2.0897    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8066   -2.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5412   -2.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4489   -1.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6364    1.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3485    1.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3485    0.6439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6382    0.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9215    0.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6364    2.7067    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.0633    0.2312    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  1 14  2  0
  9 15  2  0
  9 16  2  0
  1 17  1  0
 18 13  1  0
 18 19  1  0
 19 20  2  0
 21 20  1  0
 13 21  2  0
 20 22  1  0
 23 17  1  0
 23 24  1  0
 25 22  1  0
 25 26  1  0
 26 27  2  0
 28 27  1  0
 22 28  2  0
 29 24  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 24 33  1  0
 29 34  1  0
 31 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282959

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 570.50Molecular Weight (Monoisotopic): 568.9707AlogP: 6.01#Rotatable Bonds: 9
Polar Surface Area: 108.83Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: -1.87CX Basic pKa: CX LogP: 3.63CX LogD: 2.79
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -2.14

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source