1-(7-methoxy-1-(10H-phenothiazine-3-carbonyl)indolizin-3-yl)ethan-1-one

ID: ALA5282982

Max Phase: Preclinical

Molecular Formula: C24H18N2O3S

Molecular Weight: 414.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccn2c(C(C)=O)cc(C(=O)c3ccc4c(c3)Sc3ccccc3N4)c2c1

Standard InChI:  InChI=1S/C24H18N2O3S/c1-14(27)20-13-17(21-12-16(29-2)9-10-26(20)21)24(28)15-7-8-19-23(11-15)30-22-6-4-3-5-18(22)25-19/h3-13,25H,1-2H3

Standard InChI Key:  BCMHNIFQYIRJNQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -4.0169    0.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3023    0.8338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5903    0.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5903   -0.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3005   -0.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0169   -0.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8758    0.8345    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1611    0.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1611   -0.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8758   -0.8158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4484    0.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2664    0.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2683   -0.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4433   -0.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9810    0.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9810    1.6580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6957    0.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4103    0.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0290    0.2615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6983   -0.4729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8742   -0.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5957    1.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3999    1.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0169    1.3350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8365    0.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1110   -1.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9361   -1.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6983   -1.9022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5805    2.7071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9736    3.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  4 10  1  0
  8 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 12 15  1  0
 15 16  2  0
 15 17  1  0
 18 17  2  0
 18 19  1  0
 19 20  1  0
 21 20  2  0
 17 21  1  0
 18 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 19 25  1  0
 20 26  1  0
 26 27  1  0
 26 28  2  0
 23 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5282982

    ---

Associated Targets(Human)

MDA-MB-435 (38290 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.49Molecular Weight (Monoisotopic): 414.1038AlogP: 5.59#Rotatable Bonds: 4
Polar Surface Area: 59.81Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.04CX LogD: 4.04
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -0.70

References

1. Shuai W, Wang G, Zhang Y, Bu F, Zhang S, Miller DD, Li W, Ouyang L, Wang Y..  (2021)  Recent Progress on Tubulin Inhibitors with Dual Targeting Capabilities for Cancer Therapy.,  64  (12.0): [PMID:34101463] [10.1021/acs.jmedchem.1c00100]

Source