The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(((3S,4R)-4-((3,4-dichlorophenyl)sulfonyl)-1,1-dioxidotetrahydrothiophen-3-yl)amino)ethane-1-sulfonamide ID: ALA5282987
Max Phase: Preclinical
Molecular Formula: C12H16Cl2N2O6S3
Molecular Weight: 451.38
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)CCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(Cl)c(Cl)c1
Standard InChI: InChI=1S/C12H16Cl2N2O6S3/c13-9-2-1-8(5-10(9)14)25(21,22)12-7-23(17,18)6-11(12)16-3-4-24(15,19)20/h1-2,5,11-12,16H,3-4,6-7H2,(H2,15,19,20)/t11-,12-/m0/s1
Standard InChI Key: TZYOKZXGKCLYKY-RYUDHWBXSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
-0.6729 0.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1520 0.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4021 -0.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2512 -1.0498 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.9187 -0.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0852 0.9391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9100 0.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3223 0.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1471 0.2248 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.5644 0.9391 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.3891 0.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8017 1.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 1.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0364 0.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6275 0.2265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 0.2218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8612 0.9380 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.0399 -0.4876 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.5644 1.7653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1493 1.3522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6644 -1.7653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1602 -1.7653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5594 -0.4894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1471 1.0511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8612 0.6387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 1 0
5 4 1 0
1 6 1 6
6 7 1 0
7 8 1 0
8 9 1 0
2 10 1 1
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
14 17 1 0
15 18 1 0
10 19 2 0
10 20 2 0
4 21 2 0
4 22 2 0
9 23 1 0
9 24 2 0
9 25 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.38Molecular Weight (Monoisotopic): 449.9548AlogP: -0.19#Rotatable Bonds: 6Polar Surface Area: 140.47Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.50CX Basic pKa: 5.87CX LogP: -0.81CX LogD: -0.83Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.61Np Likeness Score: -1.67
References 1. Jo J, Kim J, Ibrahim L, Kumar M, Iaconelli J, Tran CS, Moon HR, Jung Y, Wiseman RL, Lairson LL, Chatterjee AK, Bollong MJ, Yun H.. (2023) Optimization of 3-aminotetrahydrothiophene 1,1-dioxides with improved potency and efficacy as non-electrophilic antioxidant response element (ARE) activators., 89 [PMID:37116763 ] [10.1016/j.bmcl.2023.129306 ]