The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((6-((3,5-bis(trifluoromethyl)benzyl)amino)pyrimidin-4-yl)oxy)phenyl)-2-chloroacetamide ID: ALA5283012
Max Phase: Preclinical
Molecular Formula: C21H15ClF6N4O2
Molecular Weight: 504.82
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCl)Nc1cccc(Oc2cc(NCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ncn2)c1
Standard InChI: InChI=1S/C21H15ClF6N4O2/c22-9-18(33)32-15-2-1-3-16(7-15)34-19-8-17(30-11-31-19)29-10-12-4-13(20(23,24)25)6-14(5-12)21(26,27)28/h1-8,11H,9-10H2,(H,32,33)(H,29,30,31)
Standard InChI Key: SYFIOVQEHUOPSD-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
-3.1753 1.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2064 0.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5069 0.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5383 -0.5334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2654 -0.9186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9686 -0.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9372 0.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6993 -0.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8387 -0.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1102 -0.5832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4107 -1.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3166 -0.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0198 -1.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9958 -1.8993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2613 -2.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4418 -1.8448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7484 -0.6790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4480 -1.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 -0.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8781 -1.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8443 -2.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1138 -2.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4141 -1.9447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6100 -0.7938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6461 0.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3779 0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4139 1.2353 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.9464 0.4675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8738 1.9961 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.4606 1.9694 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.1753 2.3820 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.7330 -1.6868 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.4139 -0.4496 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.4139 -1.2748 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 2 0
4 5 1 0
6 5 2 0
2 7 2 0
7 6 1 0
8 6 1 0
4 9 1 0
9 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
16 11 1 0
13 17 1 0
17 18 1 0
19 18 1 0
20 19 2 0
20 21 1 0
22 21 2 0
18 23 2 0
23 22 1 0
20 24 1 0
25 24 1 0
25 26 1 0
27 26 1 0
25 28 2 0
1 29 1 0
1 30 1 0
1 31 1 0
8 32 1 0
8 33 1 0
8 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.82Molecular Weight (Monoisotopic): 504.0788AlogP: 6.10#Rotatable Bonds: 7Polar Surface Area: 76.14Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.08CX Basic pKa: 4.71CX LogP: 5.47CX LogD: 5.47Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -1.60
References 1. Kim DR, Orr MJ, Kwong AJ, Deibler KK, Munshi HH, Bridges CS, Chen TJ, Zhang X, Lacorazza HD, Scheidt KA.. (2023) Rational Design of Highly Potent and Selective Covalent MAP2K7 Inhibitors., 14 (5): [PMID:37197477 ] [10.1021/acsmedchemlett.3c00029 ] 2. Patel, Snahel S and 19 more authors. 2015-10-22 Scaffold-Hopping and Structure-Based Discovery of Potent, Selective, And Brain Penetrant N-(1H-Pyrazol-3-yl)pyridin-2-amine Inhibitors of Dual Leucine Zipper Kinase (DLK, MAP3K12). [PMID:26431428 ]