The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S,4R,5R,6R)-5-amino-6-(4-(4-carboxy-3-pentadecylphenyl)-1H-1,2,3-triazol-1-yl)-3,4-dihydroxytetrahydro-2H-pyran-2-carboxylic acid ID: ALA5283021
Max Phase: Preclinical
Molecular Formula: C30H46N4O7
Molecular Weight: 574.72
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCc1cc(-c2cn([C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3N)nn2)ccc1C(=O)O
Standard InChI: InChI=1S/C30H46N4O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-18-21(16-17-22(20)29(37)38)23-19-34(33-32-23)28-24(31)25(35)26(36)27(41-28)30(39)40/h16-19,24-28,35-36H,2-15,31H2,1H3,(H,37,38)(H,39,40)/t24-,25-,26+,27+,28-/m1/s1
Standard InChI Key: CBHOHJQIXUMOHW-URYJJRPLSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
-3.4158 0.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7032 1.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9609 0.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9609 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7032 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4158 0.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2483 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5060 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2065 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6614 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4037 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1163 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8585 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6008 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3134 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0557 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7683 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5106 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2232 0.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9655 -0.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2483 1.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2483 2.2412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5060 0.9942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1654 -0.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1654 -1.1652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0090 -1.4276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9868 -0.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6670 1.5070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.0998 0.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9655 0.7573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.6670 0.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8014 0.0077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.3686 -0.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5029 -0.7419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.8013 -1.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6670 -1.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0998 -0.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9655 -0.7419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.0998 -2.2412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.3685 -2.2412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
3 22 1 0
22 23 2 0
22 24 1 0
6 25 1 0
26 25 1 0
26 27 2 0
25 28 2 0
30 29 1 0
30 31 2 0
32 30 1 1
33 32 1 0
34 33 1 0
28 35 1 0
27 35 1 0
34 35 1 1
36 34 1 0
37 36 1 0
38 37 1 0
32 38 1 0
38 39 1 6
37 40 1 1
36 41 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.72Molecular Weight (Monoisotopic): 574.3366AlogP: 4.31#Rotatable Bonds: 18Polar Surface Area: 181.02Molecular Species: ACIDHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 2.99CX Basic pKa: 8.31CX LogP: 3.73CX LogD: 0.66Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: 0.22
References 1. Imai Y, Wakasugi D, Suzuki R, Kato S, Sugisaki M, Mima M, Miyagawa H, Endo M, Fujimoto N, Fukunaga T, Kato S, Kuroda S, Takahashi T, Kakinuma H.. (2023) Lead identification of novel tetrahydroimidazo[1,2-a]pyridine-5-carboxylic acid derivative as a potent heparanase-1 inhibitor., 79 [PMID:36368497 ] [10.1016/j.bmcl.2022.129050 ]