(-)-ent-costunolide

ID: ALA5283090

Max Phase: Preclinical

Molecular Formula: C15H20O2

Molecular Weight: 232.32

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(=O)O[C@H]2/C=C(\C)CC/C=C(\C)CC[C@H]12

Standard InChI:  InChI=1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h5,9,13-14H,3-4,6-8H2,1-2H3/b10-5+,11-9+/t13-,14+/m1/s1

Standard InChI Key:  HRYLQFBHBWLLLL-STBPJCCXSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   -0.5767   -0.6044    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0066   -0.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1849   -0.8216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0087   -0.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4211   -1.6283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3392   -0.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1360    0.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7208    0.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5176    0.6047    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7208    1.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0066    1.6283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7076    1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4218    1.6283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1360    1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1360    0.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4218   -0.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4218   -0.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7076    0.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0067    0.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  0
  4  5  2  0
  6  4  1  0
  6  7  2  0
  8  6  1  0
  2  8  1  0
  8  9  1  1
  8 10  1  0
 10 11  1  0
 12 11  1  0
 12 13  2  0
 14 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 18  2  1  0
 12 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283090

    ---

Associated Targets(non-human)

P388 (20296 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 232.32Molecular Weight (Monoisotopic): 232.1463AlogP: 3.55#Rotatable Bonds:
Polar Surface Area: 26.30Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.82CX LogD: 3.82
Aromatic Rings: Heavy Atoms: 17QED Weighted: 0.36Np Likeness Score: 3.38

References

1. Asakawa Y, Ludwiczuk A..  (2018)  Chemical Constituents of Bryophytes: Structures and Biological Activity.,  81  (3): [PMID:29019405] [10.1021/acs.jnatprod.6b01046]

Source