(2R)-N-[(3S)-8-methoxy-1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]-N'-propyl-2-(3,3,3-trifluoropropyl)butanediamide

ID: ALA5283121

Max Phase: Preclinical

Molecular Formula: C27H31F3N4O4

Molecular Weight: 532.56

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCNC(=O)C[C@@H](CCC(F)(F)F)C(=O)N[C@H]1N=C(c2ccccc2)c2ccc(OC)cc2N(C)C1=O

Standard InChI:  InChI=1S/C27H31F3N4O4/c1-4-14-31-22(35)15-18(12-13-27(28,29)30)25(36)33-24-26(37)34(2)21-16-19(38-3)10-11-20(21)23(32-24)17-8-6-5-7-9-17/h5-11,16,18,24H,4,12-15H2,1-3H3,(H,31,35)(H,33,36)/t18-,24-/m1/s1

Standard InChI Key:  IVQHGYMDJDMREI-HOYKHHGWSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   -2.0538    0.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3396   -0.0775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3396   -0.9048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0519   -1.3177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6834   -1.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1249   -1.2307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4796   -0.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1111    0.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6954    0.4420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9094    1.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6964    0.8506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3072   -0.4823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7209    0.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5486    0.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9624    0.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7901    0.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2040    1.6678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2040    0.2341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9623   -0.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5486   -1.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9623   -1.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3072    0.9510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8975   -2.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3125   -2.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5267   -3.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3266   -3.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9102   -3.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7006   -2.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5484   -2.6324    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.7898   -1.9157    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1764   -2.7151    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7706   -0.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7706   -0.9085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4873    0.3359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2040   -0.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7900    2.3845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2038    3.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7899    3.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  3  5  1  0
  5  6  2  0
  7  6  1  0
  8  7  1  0
  2  9  1  0
  9  8  1  0
  9 10  1  0
  8 11  2  0
  7 12  1  1
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 14 19  1  1
 19 20  1  0
 20 21  1  0
 13 22  2  0
  5 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 21 29  1  0
 21 30  1  0
 21 31  1  0
  1 32  2  0
 32 33  1  0
 33  4  2  0
 32 34  1  0
 34 35  1  0
 17 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283121

    ---

Associated Targets(non-human)

Cryptosporidium parvum (1150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.56Molecular Weight (Monoisotopic): 532.2297AlogP: 3.83#Rotatable Bonds: 10
Polar Surface Area: 100.10Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.15CX Basic pKa: 0.45CX LogP: 3.48CX LogD: 3.48
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.49Np Likeness Score: -0.28

References

1. Lee S, Love MS, Modukuri R, Chatterjee AK, Huerta L, Lawson AP, McNamara CW, Mead JR, Hedstrom L, Cuny GD..  (2023)  Structure-activity relationship of BMS906024 derivatives for Cryptosporidium parvum growth inhibition.,  90  [PMID:37196868] [10.1016/j.bmcl.2023.129328]

Source