(R)-4'-(2-oxo-3-(3-(4-(trifluoromethyl)phenyl)ureido)piperidin-1-yl)-[1,1'-biphenyl]-2-carboxamide

ID: ALA5283144

Max Phase: Preclinical

Molecular Formula: C26H23F3N4O3

Molecular Weight: 496.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)c1ccccc1-c1ccc(N2CCC[C@@H](NC(=O)Nc3ccc(C(F)(F)F)cc3)C2=O)cc1

Standard InChI:  InChI=1S/C26H23F3N4O3/c27-26(28,29)17-9-11-18(12-10-17)31-25(36)32-22-6-3-15-33(24(22)35)19-13-7-16(8-14-19)20-4-1-2-5-21(20)23(30)34/h1-2,4-5,7-14,22H,3,6,15H2,(H2,30,34)(H2,31,32,36)/t22-/m1/s1

Standard InChI Key:  PURUWPLYNJDKEY-JOCHJYFZSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -4.2695   -0.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2695   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5561   -1.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8490   -1.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8490   -0.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5579    0.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1373    0.0037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4256   -0.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139    0.0037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0022   -0.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7093    0.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7093    0.8255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4210   -0.4071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1327    0.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0022   -1.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7093   -1.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4210   -1.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4256   -1.2288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1329    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8428    1.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5547    0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5563    0.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8474   -0.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2664    1.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2666    2.0562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9765    2.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6884    2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6900    1.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9811    0.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9812   -1.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9812   -2.4652    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6928   -1.2325    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6928   -2.0543    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.9811    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6928   -0.4108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2694   -0.4108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  1
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 10 15  1  0
 15 16  1  0
 16 17  1  0
 13 17  1  0
  8 18  2  0
 19 14  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 14 23  1  0
 24 21  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 24 29  1  0
 29 28  2  0
  2 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
 29 34  1  0
 34 35  1  0
 34 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5283144

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.49Molecular Weight (Monoisotopic): 496.1722AlogP: 4.79#Rotatable Bonds: 5
Polar Surface Area: 104.53Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.43CX Basic pKa: CX LogP: 3.87CX LogD: 3.87
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.47Np Likeness Score: -1.39

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source