2-(3,7-dimethylocta-2,6-dien-1-yl)-5-(1-((2R,4aR,9aR)-2-hydroxy-5-methoxy-1,1,4a-trimethyl-2,3,4,4a,9,9a-hexahydro-1H-xanthen-7-yl)-1H-1,2,3-triazol-4-yl)benzene-1,3-diol

ID: ALA5283163

Max Phase: Preclinical

Molecular Formula: C35H45N3O5

Molecular Weight: 587.76

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(-n2cc(-c3cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c3)nn2)cc2c1O[C@]1(C)CC[C@@H](O)C(C)(C)[C@H]1C2

Standard InChI:  InChI=1S/C35H45N3O5/c1-21(2)9-8-10-22(3)11-12-26-28(39)16-23(17-29(26)40)27-20-38(37-36-27)25-15-24-18-31-34(4,5)32(41)13-14-35(31,6)43-33(24)30(19-25)42-7/h9,11,15-17,19-20,31-32,39-41H,8,10,12-14,18H2,1-7H3/b22-11+/t31-,32-,35-/m1/s1

Standard InChI Key:  VOXDMVZGEDBMIW-XKBAZTDFSA-N

Molfile:  

 
     RDKit          2D

 44 48  0  0  0  0  0  0  0  0999 V2000
   -3.6595    0.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9449    1.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2329    0.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2329   -0.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9431   -0.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6595   -0.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3769   -0.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0944   -0.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0944    0.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3769    1.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8120   -0.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5295   -0.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5295    0.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8120    1.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2467   -0.5946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9449    1.8883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5156   -0.5910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2268   -1.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3986   -1.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0944   -1.0088    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0944    1.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6621    2.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7594   -0.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2054   -0.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6193   -1.5865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292   -1.4144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6227   -0.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0371   -0.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8629   -0.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2772   -0.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8665   -1.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0387   -1.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2770    0.5641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2806   -2.3024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1054   -0.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5196   -0.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3478   -0.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7619    0.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7619   -0.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5902    0.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0043    1.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8326    1.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2467    1.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2467    0.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  1 10  1  0
  8 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  9 14  1  0
 12 15  1  6
  2 16  1  0
  4 17  1  0
 11 18  1  0
 11 19  1  0
  8 20  1  1
  9 21  1  6
 16 22  1  0
 23 17  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 17  1  0
 24 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 29 33  1  0
 31 34  1  0
 30 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 37 39  1  0
 38 40  1  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 42 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283163

    ---

Associated Targets(Human)

SF-295 (48000 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Panel NCI-60 (60 carcinoma cell lines) (1088 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.76Molecular Weight (Monoisotopic): 587.3359AlogP: 7.08#Rotatable Bonds: 8
Polar Surface Area: 109.86Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.58CX Basic pKa: CX LogP: 7.58CX LogD: 7.56
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.24Np Likeness Score: 1.38

References

1. Stockdale DP, Beutler JA, Wiemer DF..  (2022)  Substitution of a triazole for the central olefin in biologically active stilbenes.,  75  [PMID:36096344] [10.1016/j.bmcl.2022.128980]

Source