The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{N-[8-(4-imino-2-oxo-1,3,5-triazacyclotridecan-1-yl)octyl]carbamimidoyl}-3-methylurea ID: ALA5283183
Max Phase: Preclinical
Molecular Formula: C21H42N8O2
Molecular Weight: 438.62
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)NC(=N)NCCCCCCCCN1CCCCCCCCNC(=N)NC1=O
Standard InChI: InChI=1S/C21H42N8O2/c1-24-20(30)27-18(22)25-14-10-6-2-4-8-12-16-29-17-13-9-5-3-7-11-15-26-19(23)28-21(29)31/h2-17H2,1H3,(H3,23,26,28,31)(H4,22,24,25,27,30)
Standard InChI Key: MFPRZYJZMSHFPK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
-4.9974 2.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2818 2.4644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5686 2.0499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5709 1.2249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8577 0.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5167 -0.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8713 -1.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6889 -1.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0047 -0.4205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7178 -0.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7152 0.8186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9997 1.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8544 2.4623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1435 1.2230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1446 -0.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4316 -0.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7163 -0.4205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0032 -0.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7121 -0.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4253 -0.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1407 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8537 0.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5693 -0.4086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2823 0.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9977 -0.4046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0000 -1.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7155 -1.6397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7178 -2.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2869 -1.6437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2800 0.8304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8600 -0.0141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
4 5 1 0
7 6 1 0
8 7 1 0
9 8 1 0
10 9 1 0
10 11 1 0
1 12 1 0
12 11 1 0
3 13 2 0
5 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 2 0
24 30 2 0
15 31 1 0
5 31 1 0
6 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.62Molecular Weight (Monoisotopic): 438.3431AlogP: 2.67#Rotatable Bonds: 9Polar Surface Area: 145.23Molecular Species: BASEHBA: 4HBD: 7#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.08CX Basic pKa: 9.83CX LogP: 2.07CX LogD: 0.11Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.17Np Likeness Score: -0.40
References 1. Balestri LJI, Trivisani CI, Orofino F, Fiorucci D, Truglio GI, D'Agostino I, Poggialini F, Botta L, Docquier JD, Dreassi E.. (2023) Discovery and Optimization of a Novel Macrocyclic Amidinourea Series Active as Acidic Mammalian Chitinase Inhibitors., 14 (4): [PMID:37077400 ] [10.1021/acsmedchemlett.2c00472 ]