The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2,2,6,6-tetramethyl-4-(3-{[methyl(prop-2-yn-1-yl)amino]methyl}benzamido)piperidin-1-yl]oxidanyl ID: ALA5283202
Max Phase: Preclinical
Molecular Formula: C21H30N3O2
Molecular Weight: 356.49
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(C)Cc1cccc(C(=O)NC2CC(C)(C)N([O])C(C)(C)C2)c1
Standard InChI: InChI=1S/C21H30N3O2/c1-7-11-23(6)15-16-9-8-10-17(12-16)19(25)22-18-13-20(2,3)24(26)21(4,5)14-18/h1,8-10,12,18H,11,13-15H2,2-6H3,(H,22,25)
Standard InChI Key: JMBHPIIINCMWLR-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
2.1924 1.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1924 0.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9069 -0.0965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9069 -0.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1924 -1.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4779 -0.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4779 -0.0965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7634 -1.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0489 -0.9215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6654 -1.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6654 -2.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3799 -2.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0944 -2.1589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0944 -1.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3799 -0.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9069 -1.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3766 -0.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8089 -2.5715 0.0000 O 0 0 0 0 0 1 0 0 0 0 0 0
-1.9102 -3.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8496 -3.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7634 -2.1589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4779 1.5534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4779 2.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7634 2.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0489 3.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7634 1.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
2 7 2 0
7 6 1 0
6 8 1 0
8 9 1 0
9 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
10 15 1 0
14 16 1 0
14 17 1 0
13 18 1 0
12 19 1 0
12 20 1 0
8 21 2 0
1 22 1 0
22 23 1 0
23 24 1 0
24 25 3 0
22 26 1 0
M RAD 1 18 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 356.49Molecular Weight (Monoisotopic): 356.2338AlogP: 2.85#Rotatable Bonds: 5Polar Surface Area: 55.48Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.36CX LogP: 1.96CX LogD: 1.68Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.83Np Likeness Score: -1.05