[2,2,6,6-tetramethyl-4-(3-{[methyl(prop-2-yn-1-yl)amino]methyl}benzamido)piperidin-1-yl]oxidanyl

ID: ALA5283202

Max Phase: Preclinical

Molecular Formula: C21H30N3O2

Molecular Weight: 356.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C#CCN(C)Cc1cccc(C(=O)NC2CC(C)(C)N([O])C(C)(C)C2)c1

Standard InChI:  InChI=1S/C21H30N3O2/c1-7-11-23(6)15-16-9-8-10-17(12-16)19(25)22-18-13-20(2,3)24(26)21(4,5)14-18/h1,8-10,12,18H,11,13-15H2,2-6H3,(H,22,25)

Standard InChI Key:  JMBHPIIINCMWLR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
    2.1924    1.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1924    0.3160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9069   -0.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9069   -0.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1924   -1.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4779   -0.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4779   -0.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7634   -1.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0489   -0.9215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6654   -1.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6654   -2.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3799   -2.5715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0944   -2.1589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0944   -1.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3799   -0.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9069   -1.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3766   -0.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8089   -2.5715    0.0000 O   0  0  0  0  0  1  0  0  0  0  0  0
   -1.9102   -3.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8496   -3.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7634   -2.1589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4779    1.5534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4779    2.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7634    2.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0489    3.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7634    1.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  2  7  2  0
  7  6  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 10 15  1  0
 14 16  1  0
 14 17  1  0
 13 18  1  0
 12 19  1  0
 12 20  1  0
  8 21  2  0
  1 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  3  0
 22 26  1  0
M  RAD  1  18   2
M  END

Alternative Forms

  1. Parent:

    ALA5283202

    ---

Associated Targets(Human)

MAOA Tclin Monoamine oxidase A (11911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 356.49Molecular Weight (Monoisotopic): 356.2338AlogP: 2.85#Rotatable Bonds: 5
Polar Surface Area: 55.48Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.36CX LogP: 1.96CX LogD: 1.68
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.83Np Likeness Score: -1.05

References

1. Tripathi AC, Upadhyay S, Paliwal S, Saraf SK..  (2018)  Privileged scaffolds as MAO inhibitors: Retrospect and prospects.,  145  [PMID:29335210] [10.1016/j.ejmech.2018.01.003]

Source