1-[(3S,4R)-4-(2,6-difluoro-4-methoxy-phenyl)-2-oxo-pyrrolidin-3-yl]-3-[1-[3-(trifluoromethyl)phenyl]cyclopropyl]urea

ID: ALA5283221

Max Phase: Preclinical

Molecular Formula: C22H20F5N3O3

Molecular Weight: 469.41

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(F)c([C@@H]2CNC(=O)[C@H]2NC(=O)NC2(c3cccc(C(F)(F)F)c3)CC2)c(F)c1

Standard InChI:  InChI=1S/C22H20F5N3O3/c1-33-13-8-15(23)17(16(24)9-13)14-10-28-19(31)18(14)29-20(32)30-21(5-6-21)11-3-2-4-12(7-11)22(25,26)27/h2-4,7-9,14,18H,5-6,10H2,1H3,(H,28,31)(H2,29,30,32)/t14-,18-/m0/s1

Standard InChI Key:  UUIUVXKSLUPIBR-KSSFIOAISA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -1.5588    0.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8444    1.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1296    0.7534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5851    1.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2997    0.7534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5851    1.9913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0145    1.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1007    1.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9076    2.1579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3201    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7680    0.8305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9816    0.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7788   -0.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9910   -0.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4073   -1.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6136   -1.3481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3956   -0.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5171    2.5699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4310    1.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2562    1.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5591   -0.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2720   -0.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9870   -0.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9886    0.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2767    1.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7033    1.1640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4181    0.7513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7033    1.9893    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4181    1.5767    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5984   -0.3391    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.3624    0.4030    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6209   -2.3563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4181   -2.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  7  5  1  6
  8  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 11 12  1  1
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 12 17  1  0
 17 16  2  0
  8 18  2  0
  2 19  1  0
 19 20  1  0
  2 20  1  0
 21  1  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
  1 25  1  0
 24 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
 17 30  1  0
 13 31  1  0
 15 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283221

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.41Molecular Weight (Monoisotopic): 469.1425AlogP: 3.56#Rotatable Bonds: 5
Polar Surface Area: 79.46Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.51CX Basic pKa: CX LogP: 2.81CX LogD: 2.81
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.59Np Likeness Score: -0.72

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source