The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[(3S,4R)-4-(2,6-difluoro-4-methoxy-phenyl)-2-oxo-pyrrolidin-3-yl]-3-[1-[3-(trifluoromethyl)phenyl]cyclopropyl]urea ID: ALA5283221
Max Phase: Preclinical
Molecular Formula: C22H20F5N3O3
Molecular Weight: 469.41
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(F)c([C@@H]2CNC(=O)[C@H]2NC(=O)NC2(c3cccc(C(F)(F)F)c3)CC2)c(F)c1
Standard InChI: InChI=1S/C22H20F5N3O3/c1-33-13-8-15(23)17(16(24)9-13)14-10-28-19(31)18(14)29-20(32)30-21(5-6-21)11-3-2-4-12(7-11)22(25,26)27/h2-4,7-9,14,18H,5-6,10H2,1H3,(H,28,31)(H2,29,30,32)/t14-,18-/m0/s1
Standard InChI Key: UUIUVXKSLUPIBR-KSSFIOAISA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-1.5588 0.7535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8444 1.1660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1296 0.7534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5851 1.1660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2997 0.7534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5851 1.9913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0145 1.1660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1007 1.9864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9076 2.1579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3201 1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7680 0.8305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9816 0.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7788 -0.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9910 -0.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4073 -1.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6136 -1.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3956 -0.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5171 2.5699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4310 1.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2562 1.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5591 -0.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2720 -0.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9870 -0.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9886 0.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2767 1.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7033 1.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4181 0.7513 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.7033 1.9893 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.4181 1.5767 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5984 -0.3391 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3624 0.4030 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6209 -2.3563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4181 -2.5699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 2 0
7 5 1 6
8 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
11 12 1 1
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
12 17 1 0
17 16 2 0
8 18 2 0
2 19 1 0
19 20 1 0
2 20 1 0
21 1 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
1 25 1 0
24 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
17 30 1 0
13 31 1 0
15 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.41Molecular Weight (Monoisotopic): 469.1425AlogP: 3.56#Rotatable Bonds: 5Polar Surface Area: 79.46Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.51CX Basic pKa: ┄CX LogP: 2.81CX LogD: 2.81Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.59Np Likeness Score: -0.72
References 1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM.. (2021) Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential., 213 [PMID:33486199 ] [10.1016/j.ejmech.2021.113167 ]