(S)-3-(4-cyanophenyl)-2-(3-(4-hydroxyphenyl)ureido)-N-((1-phenylcyclopropyl)methyl)propanamide

ID: ALA5283242

Max Phase: Preclinical

Molecular Formula: C27H26N4O3

Molecular Weight: 454.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(C[C@H](NC(=O)Nc2ccc(O)cc2)C(=O)NCC2(c3ccccc3)CC2)cc1

Standard InChI:  InChI=1S/C27H26N4O3/c28-17-20-8-6-19(7-9-20)16-24(31-26(34)30-22-10-12-23(32)13-11-22)25(33)29-18-27(14-15-27)21-4-2-1-3-5-21/h1-13,24,32H,14-16,18H2,(H,29,33)(H2,30,31,34)/t24-/m0/s1

Standard InChI Key:  VGPZEDCNIZBABH-DEOSSOPVSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    3.5684   -2.2677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8539   -1.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1395   -1.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4293   -1.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129   -1.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129   -0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1395   -0.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015    0.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129    1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129    1.8571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4273    0.6196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1418    1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8562    0.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2680   -0.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4430   -0.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5707    1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2883    0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9999    1.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9999    1.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2837    2.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5707    1.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7159    1.0320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4304    0.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4304   -0.2054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1449    1.0320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8593    0.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8593   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5693   -0.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2855   -0.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2855    0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711    1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9999   -0.6215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  3  0
  2  3  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  3  8  2  0
  9  6  1  0
 10  9  1  6
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 17 16  1  0
 15 17  1  0
 15 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 18  2  0
 24 10  1  0
 25 24  1  0
 25 26  2  0
 27 25  1  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283242

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.53Molecular Weight (Monoisotopic): 454.2005AlogP: 3.84#Rotatable Bonds: 8
Polar Surface Area: 114.25Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.39CX Basic pKa: CX LogP: 4.07CX LogD: 4.06
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -0.92

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source